PPIRE17802
Target Protein Information
| Protein_Name | Virulence-associated V antigen |
|---|---|
| Protein_Sequence | MIRAYEQNPQHFIEDLEKVRVEQLTGHGSSVLEELVQLVKDKNIDISIKYDPRKDSEVFANRVITDDIELLKKILAYFLPEDAILKGGHYDNQLQNGIKRVKEFLESSPNTQWELRAFMAVMHFSLTADRIDDDILKVIVDSMNHHGDARSKLREELAELTAELKIYSVIQAEINKHLSSSGTINIHDKSINLMDKNLYGYTDEEIFKASAEYKILEKMPQTTIQVDGSEKKIVSIKDFLGSENKRTGALGNLKNSYSYNKDNNELSHFATTCSDKSRPLNDLVSQKTTQLSDITSRFNSAIEALNRFIQKYDSVMQRLLDDTSGK |
| Organism_Source | Yersinia pestis |
| Functional_Classification | Bacterial toxins V antigen pore forming modulator |
| Cellular_Localization | Extracellular |
| Gene_Names | lcrV |
| UniProt_ID | P0C7U7 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Peptide a |
|---|---|
| Peptide_Sequence | QLVKDKNIDISIKYDPRKDSE |
| Peptide_Length | 21 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CCC(N)=O)C(C)C)[C@@H](C)CC)[C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(=O)O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2504.82 |
|---|---|
| Aliphatic_Index | 88.09524 |
| Aromaticity | 0.04762 |
| Average_Rotatable_Bonds | 4.23810 |
| Charge_at_pH_7 | -0.00049 |
| Isoelectric_Point | 6.63189 |
|---|---|
| Hydrogen_Bond_Acceptors | 37 |
| Hydrogen_Bond_Donors | 38 |
| Topological_Polar_Surface_Area | 1135.88000 |
| X_logP_energy | -10.94243 |
Interaction Information
| Affinity | IC50=20 uM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | 1R6F |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Identifying B and T cell epitopes and studying humoral mucosal and cellular immune responses of peptides derived from V antigen of Yersinia pestis |
| Release_Year | 2008 |
| PMID | 18096277 |
| DOI | 10.1016/j.vaccine.2007.11.028 |