PPIRE17995
Target Protein Information
| Protein_Name | Immunoglobulin heavy constant mu |
|---|---|
| Protein_Sequence | SQSFPNVFPLVSCESPLSDKNLVAMGCLARDFLPSTISFTWNYQNNTEVIQGIRTFPTLRTGGKYLATSQVLLSPKSILEGSDEYLVCKIHYGGKNRDLHVPIPAVAEMNPNVNVFVPPRDGFSGPAPRKSKLICEATNFTPKPITVSWLKDGKLVESGFTTDPVTIENKGSTPQTYKVISTLTISEIDWLNLNVYTCRVDHRGLTFLKNVSSTCAASPSTDILTFTIPPSFADIFLSKSANLTCLVSNLATYETLNISWASQSGEPLETKIKIMESHPNGTFSAKGVASVCVEDWNNRKEFVCTVTHRDLPSPQKKFISKPNEVHKHPPAVYLLPPAREQLNLRESATVTCLVKGFSPADISVQWLQRGQLLPQEKYVTSAPMPEPGAPGFYFTHSILTVTEEEWNSGETYTCVVGHEALPHLVTERTVDKSTGKPTLYNVSLIMSDTGGTCY |
| Organism_Source | Mus musculus |
| Functional_Classification | immunoglobulins |
| Cellular_Localization | Extracellular |
| Gene_Names | Ighm |
| UniProt_ID | P01872 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | ADGADRPVPYGACG(Orn-biotin) |
|---|---|
| Peptide_Sequence | ADGADRPVPYGACGX |
| Peptide_Length | 15 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)CNC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CS)C(=O)NCC(=O)NCC(=O)O |
| Chemical_Modification | X16=Orn-biotin |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1405.50 |
|---|---|
| Aliphatic_Index | 39.33333 |
| Aromaticity | 0.06667 |
| Average_Rotatable_Bonds | 2.60000 |
| Charge_at_pH_7 | -1.06395 |
| Isoelectric_Point | 4.10922 |
|---|---|
| Hydrogen_Bond_Acceptors | 21 |
| Hydrogen_Bond_Donors | 21 |
| Topological_Polar_Surface_Area | 609.87000 |
| X_logP_energy | -8.47003 |
Interaction Information
| Affinity | KD=625 nM |
|---|---|
| Affinity_Assay | Microscale Thermophoresis |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | NMR Studies of the Antibody-Bound Conformation of a Carbohydrate-Mimetic Peptide |
| Release_Year | 2002 |
| PMID | 11841205 |
| DOI | 10.1021/bi011927u |