PPIRE18061
Target Protein Information
| Protein_Name | Guanine nucleotide-binding protein G(i) subunit alpha-1 |
|---|---|
| Protein_Sequence | MGCTLSAEDKAAVERSKMIDRNLREDGEKAAREVKLLLLGAGESGKSTIVKQMKIIHEAGYSEEECKQYKAVVYSNTIQSIIAIIRAMGRLKIDFGDAARADDARQLFVLAGAAEEGFMTAELAGVIKRLWKDSGVQACFNRSREYQLNDSAAYYLNDLDRIAQPNYIPTQQDVLRTRVKTTGIVETHFTFKDLHFKMFDVGGQRSERKKWIHCFEGVTAIIFCVALSDYDLVLAEDEEMNRMHESMKLFDSICNNKWFTDTSIILFLNKKDLFEEKIKKSPLTICYPEYAGSNTYEEAAAYIQCQFEDLNKRKDTKEIYTHFTCATDTKNVQFVFDAVTDVIIKNNLKDCGLF |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | GTPases |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Gnai1 |
| UniProt_ID | P10824 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | R6A-1 |
|---|---|
| Peptide_Sequence | DQLYWWEYL |
| Peptide_Length | 9 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CC(=O)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1315.45 |
|---|---|
| Aliphatic_Index | 86.66667 |
| Aromaticity | 0.44444 |
| Average_Rotatable_Bonds | 4.11111 |
| Charge_at_pH_7 | -2.00149 |
| Isoelectric_Point | 3.55007 |
|---|---|
| Hydrogen_Bond_Acceptors | 15 |
| Hydrogen_Bond_Donors | 17 |
| Topological_Polar_Surface_Area | 485.85000 |
| X_logP_energy | 1.31850 |
Interaction Information
| Affinity | KD=200 nM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | In Vitro Selection of State-Specific Peptide Modulators of G Protein Signaling Using mRNA Display |
| Release_Year | 2004 |
| PMID | 15248784 |
| DOI | 10.1021/bi0498398 |