PPIRE18131
Target Protein Information
| Protein_Name | Tumor necrosis factor receptor superfamily member 1A |
|---|---|
| Protein_Sequence | MGLSTVPDLLLPLVLLELLVGIYPSGVIGLVPHLGDREKRDSVCPQGKYIHPQNNSICCTKCHKGTYLYNDCPGPGQDTDCRECESGSFTASENHLRHCLSCSKCRKEMGQVEISSCTVDRDTVCGCRKNQYRHYWSENLFQCFNCSLCLNGTVHLSCQEKQNTVCTCHAGFFLRENECVSCSNCKKSLECTKLCLPQIENVKGTEDSGTTVLLPLVIFFGLCLLSLLFIGLMYRYQRWKSKLYSIVCGKSTPEKEGELEGTTTKPLAPNPSFSPTPGFTPTLGFSPVPSSTFTSSSTYTPGDCPNFAAPRREVAPPYQGADPILATALASDPIPNPLQKWEDSAHKPQSLDTDDPATLYAVVENVPPLRWKEFVRRLGLSDHEIDRLELQNGRCLREAQYSMLATWRRRTPRREATLELLGRVLRDMDLLGCLEDIEEALCGPAALPPAPSLLR |
| Organism_Source | Homo sapiens |
| Functional_Classification | tumor necrosis factor receptors |
| Cellular_Localization | Plasma membrane |
| Gene_Names | TNFRSF1A |
| UniProt_ID | P19438 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Hydrostatin-SN1 |
|---|---|
| Peptide_Sequence | DEQHLETELHTHLTSVLTANGFQ |
| Peptide_Length | 23 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(N)=O)C(=O)O)[C@@H](C)O)C(C)C)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2620.81 |
|---|---|
| Aliphatic_Index | 84.78261 |
| Aromaticity | 0.04348 |
| Average_Rotatable_Bonds | 3.73913 |
| Charge_at_pH_7 | -3.72352 |
| Isoelectric_Point | 4.56857 |
|---|---|
| Hydrogen_Bond_Acceptors | 39 |
| Hydrogen_Bond_Donors | 39 |
| Topological_Polar_Surface_Area | 1169.18000 |
| X_logP_energy | -13.31330 |
Interaction Information
| Affinity | KD=32 uM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | None |
| Type | Antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Screening of an anti-inflammatory peptide from Hydrophis cyanocinctus and analysis of its activities and mechanism in DSS-induced acute colitis |
| Release_Year | 2016 |
| PMID | 27158082 |
| DOI | 10.1038/srep25672 |