PPIRE18502
Target Protein Information
| Protein_Name | Corticotropin-releasing factor receptor 1 |
|---|---|
| Protein_Sequence | MGGHPQLRLVKALLLLGLNPVSASLQDQHCESLSLASNISGLQCNASVDLIGTCWPRSPAGQLVVRPCPAFFYGVRYNTTNNGYRECLANGSWAARVNYSECQEILNEEKKSKVHYHVAVIINYLGHCISLVALLVAFVLFLRLRSIRCLRNIIHWNLISAFILRNATWFVVQLTMSPEVHQSNVGWCRLVTAAYNYFHVTNFFWMFGEGCYLHTAIVLTYSTDRLRKWMFICIGWGVPFPIIVAWAIGKLYYDNEKCWFGKRPGVYTDYIYQGPMILVLLINFIFLFNIVRILMTKLRASTTSETIQYRKAVKATLVLLPLLGITYMLFFVNPGEDEVSRVVFIYFNSFLESFQGFFVSVFYCFLNSEVRSAIRKRWHRWQDKHSIRARVARAMSIPTSPTRVSFHSIKQSTAV |
| Organism_Source | Homo sapiens |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | CRHR1 |
| UniProt_ID | P34998 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | cCRF30-41 |
|---|---|
| Peptide_Sequence | EAHKNRKLMEII |
| Peptide_Length | 12 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCSC)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](C)NC(=O)[C@@H](N)CCC(=O)O)[C@@H](C)CC)C(=O)O |
| Chemical_Modification | |
| Cyclization_Method | side chain-side chain cyclization; E30<-->K33; other bonds |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1481.78 |
|---|---|
| Aliphatic_Index | 105.83333 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.50000 |
| Charge_at_pH_7 | 1.09185 |
| Isoelectric_Point | 9.53692 |
|---|---|
| Hydrogen_Bond_Acceptors | 21 |
| Hydrogen_Bond_Donors | 22 |
| Topological_Polar_Surface_Area | 643.73000 |
| X_logP_energy | -4.26553 |
Interaction Information
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | NMR Structural Characterization of a Minimal Peptide Antagonist Bound to the Extracellular Domain of the Corticotropin-releasing Factor1 Receptor |
| Release_Year | 2007 |
| PMID | 17192263 |
| DOI | 10.1074/jbc.M609816200 |