PPIRE18537
Target Protein Information
| Protein_Name | Alpha-1-syntrophin |
|---|---|
| Protein_Sequence | MASGRRAPRTGLLELRAGAGSGAGGERWQRVLLSLAEDVLTVSPADGDPGPEPGAPREQEPAQLNGAAEPGAGPPQLPEALLLQRRRVTVRKADAGGLGISIKGGRENKMPILISKIFKGLAADQTEALFVGDAILSVNGEDLSSATHDEAVQVLKKTGKEVVLEVKYMKDVSPYFKNSTGGTSVGWDSPPASPLQRQPSSPGPTPRNFSEAKHMSLKMAYVSKRCTPNDPEPRYLEICSADGQDTLFLRAKDEASARSWATAIQAQVNTLTPRVKDELQALLAATSTAGSQDIKQIGWLTEQLPSGGTAPTLALLTEKELLLYLSLPETREALSRPARTAPLIATRLVHSGPSKGSVPYDAELSFALRTGTRHGVDTHLFSVESPQELAAWTRQLVDGCHRAAEGVQEVSTACTWNGRPCSLSVHIDKGFTLWAAEPGAARAVLLRQPFEKLQMSSDDGASLLFLDFGGAEGEIQLDLHSCPKTIVFIIHSFLSAKVTRLGLLA |
| Organism_Source | Homo sapiens |
| Functional_Classification | PDZ domain containing scaffold proteins |
| Cellular_Localization | Plasma membrane |
| Gene_Names | SNTA1 |
| UniProt_ID | Q13424 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Cyc15 |
|---|---|
| Peptide_Sequence | DGTPKTIpGETTFTG |
| Peptide_Length | 15 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)CNC(=O)[C@@H](N)CC(=O)O)[C@@H](C)O)[C@@H](C)O)C(=O)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)NCC(=O)O)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | p8=D-Proline |
| Cyclization_Method | Main chain-main chain cyclization; D1<-->G15; amide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1521.64 |
|---|---|
| Aliphatic_Index | 26.00000 |
| Aromaticity | 0.06667 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | -1.00009 |
| Isoelectric_Point | 4.18441 |
|---|---|
| Hydrogen_Bond_Acceptors | 24 |
| Hydrogen_Bond_Donors | 22 |
| Topological_Polar_Surface_Area | 654.91000 |
| X_logP_energy | -9.24660 |
Interaction Information
| Affinity | KD=30.4 uM |
|---|---|
| Affinity_Assay | Isothermal Titration Calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Design synthesis structure and binding properties of PDZ binding cyclic b-finger peptides |
| Release_Year | 2010 |
| PMID | 20394733 |
| DOI | 10.1016/j.bbrc.2010.04.060 |