PPIRE18601
Target Protein Information
| Protein_Name | PC4 and SFRS1-interacting protein |
|---|---|
| Protein_Sequence | MTRDFKPGDLIFAKMKGYPHWPARVDEVPDGAVKPPTNKLPIFFFGTHETAFLGPKDIFPYSENKEKYGKPNKRKGFNEGLWEIDNNPKVKFSSQQAATKQSNASSDVEVEEKETSVSKEDTDHEEKASNEDVTKAVDITTPKAARRGRKRKAEKQVETEEAGVVTTATASVNLKVSPKRGRPAATEVKIPKPRGRPKMVKQPCPSESDIITEEDKSKKKGQEEKQPKKQPKKDEEGQKEEDKPRKEPDKKEGKKEVESKRKNLAKTGVTSTSDSEEEGDDQEGEKKRKGGRNFQTAHRRNMLKGQHEKEAADRKRKQEEQMETEQQNKDEGKKPEVKKVEKKRETSMDSRLQRIHAEIKNSLKIDNLDVNRCIEALDELASLQVTMQQAQKHTEMITTLKKIRRFKVSQVIMEKSTMLYNKFKNMFLVGEGDSVITQVLNKSLAEQRQHEEANKTKDQGKKGPNKKLEKEQTGSKTLNGGSDAQDGNQPQHNGESNEDSKDNHEASTKKKPSSEERETEISLKDSTLDN |
| Organism_Source | Homo sapiens |
| Functional_Classification | histone methyllysine reader |
| Cellular_Localization | Nucleus |
| Gene_Names | PSIP1 |
| UniProt_ID | O75475 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | H3PE6 |
|---|---|
| Peptide_Sequence | SAPATGGVXKPEEEEEE |
| Peptide_Length | 17 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)CNC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@@H](N)CO)[C@@H](C)O)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| Chemical_Modification | X9=trimethyllysine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1715.74 |
|---|---|
| Aliphatic_Index | 28.82353 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.29412 |
| Charge_at_pH_7 | -4.99166 |
| Isoelectric_Point | 3.61871 |
|---|---|
| Hydrogen_Bond_Acceptors | 27 |
| Hydrogen_Bond_Donors | 25 |
| Topological_Polar_Surface_Area | 801.62000 |
| X_logP_energy | -10.55160 |
Interaction Information
| Affinity | KD=1.74 mM |
|---|---|
| Affinity_Assay | NMR chemical shift perturbation |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Mimicking the Nucleosomal Context in Peptide-Based Binders of a H3K36me Reader Increases Binding Affinity While Altering the Binding Mode |
| Release_Year | 2020 |
| PMID | 33114657 |
| DOI | 10.3390/molecules25214951 |