PPIRE18717
Target Protein Information
| Protein_Name | Ig gamma chain C region |
|---|---|
| Protein_Sequence | GQPKAPSVFPLAPCCGDTPSSTVTLGCLVKGYLPEPVTVTWNSGTLTNGVRTFPSVRQSSGLYSLSSVVSVTSSSQPVTCNVAHPATNTKVDKTVAPSTCSKPTCPPPELLGGPSVFIFPPKPKDTLMISRTPEVTCVVVDVSQDDPEVQFTWYINNEQVRTARPPLREQQFNSTIRVVSTLPITHQDWLRGKEFKCKVHNKALPAPIEKTISKARGQPLEPKVYTMGPPREELSSRSVSLTCMINGFYPSDISVEWEKNGKAEDNYKTTPAVLDSDGSYFLYNKLSVPTSEWQRGDVFTCSVMHEALHNHYTQKSISRSPGK |
| Organism_Source | Oryctolagus cuniculus |
| Functional_Classification | immunoglobulin G |
| Cellular_Localization | Extracellular |
| Gene_Names | None |
| UniProt_ID | P01870 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | DWFYEWTV |
|---|---|
| Peptide_Sequence | DWFYEWTV |
| Peptide_Length | 8 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)CC(=O)O)[C@@H](C)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1145.24 |
|---|---|
| Aliphatic_Index | 36.25000 |
| Aromaticity | 0.50000 |
| Average_Rotatable_Bonds | 3.75000 |
| Charge_at_pH_7 | -2.00064 |
| Isoelectric_Point | 3.55007 |
|---|---|
| Hydrogen_Bond_Acceptors | 13 |
| Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 413.66000 |
| X_logP_energy | 0.80720 |
Interaction Information
| Affinity | IC50=73 nM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Analyte Peptidomimetics Selected from Phage Display Peptide Libraries: A Systematic Strategy for the Development of Environmental Immunoassays |
| Release_Year | 2005 |
| PMID | 15984805 |
| DOI | 10.1021/es047931l |