PPIRE18815
Target Protein Information
| Protein_Name | Tyrosine-protein kinase Lck |
|---|---|
| Protein_Sequence | MGCGCSSHPEDDWMENIDVCENCHYPIVPLDGKGTLLIRNGSEVRDPLVTYEGSNPPASPLQDNLVIALHSYEPSHDGDLGFEKGEQLRILEQSGEWWKAQSLTTGQEGFIPFNFVAKANSLEPEPWFFKNLSRKDAERQLLAPGNTHGSFLIRESESTAGSFSLSVRDFDQNQGEVVKHYKIRNLDNGGFYISPRITFPGLHELVRHYTNASDGLCTRLSRPCQTQKPQKPWWEDEWEVPRETLKLVERLGAGQFGEVWMGYYNGHTKVAVKSLKQGSMSPDAFLAEANLMKQLQHQRLVRLYAVVTQEPIYIITEYMENGSLVDFLKTPSGIKLTINKLLDMAAQIAEGMAFIEERNYIHRDLRAANILVSDTLSCKIADFGLARLIEDNEYTAREGAKFPIKWTAPEAINYGTFTIKSDVWSFGILLTEIVTHGRIPYPGMTNPEVIQNLERGYRMVRPDNCPEELYQLMRLCWKERPEDRPTFDYLRSVLEDFFTATEGQYQPQP |
| Organism_Source | Homo sapiens |
| Functional_Classification | tyrosine kinases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | LCK |
| UniProt_ID | P06239 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | CD8R |
|---|---|
| Peptide_Sequence | RRRVCKCPRPVVKSY |
| Peptide_Length | 15 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CS)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)C(C)C)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1847.28 |
|---|---|
| Aliphatic_Index | 58.00000 |
| Aromaticity | 0.06667 |
| Average_Rotatable_Bonds | 3.93333 |
| Charge_at_pH_7 | 5.87258 |
| Isoelectric_Point | 11.50709 |
|---|---|
| Hydrogen_Bond_Acceptors | 26 |
| Hydrogen_Bond_Donors | 32 |
| Topological_Polar_Surface_Area | 793.24000 |
| X_logP_energy | -7.72282 |
Interaction Information
| Affinity | KD=45.45 uM |
|---|---|
| Affinity_Assay | UV/visible absorption spectroscopy with cobalt(II) |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Homodimerization and Heterodimerization of Minimal Zinc(II)-Binding-Domain Peptides of T-Cell Proteins CD4 CD8r and Lck |
| Release_Year | 2009 |
| PMID | 19624124 |
| DOI | 10.1021/ja9028928 |