PPIRE18828
Target Protein Information
| Protein_Name | Secretin receptor |
|---|---|
| Protein_Sequence | MLSTMRPRLSLLLLRLLLLTKAAHTVGVPPRLCDVRRVLLEERAHCLQQLSKEKKGALGPETASGCEGLWDNMSCWPSSAPARTVEVQCPKFLLMLSNKNGSLFRNCTQDGWSETFPRPDLACGVNINNSFNERRHAYLLKLKVMYTVGYSSSLAMLLVALSILCSFRRLHCTRNYIHMHLFVSFILRALSNFIKDAVLFSSDDVTYCDAHKVGCKLVMIFFQYCIMANYAWLLVEGLYLHTLLAISFFSERKYLQAFVLLGWGSPAIFVALWAITRHFLENTGCWDINANASVWWVIRGPVILSILINFIFFINILRILMRKLRTQETRGSETNHYKRLAKSTLLLIPLFGIHYIVFAFSPEDAMEVQLFFELALGSFQGLVVAVLYCFLNGEVQLEVQKKWRQWHLQEFPLRPVAFNNSFSNATNGPTHSTKASTEQSRSIPRASII |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | class 2 G protein coupled receptors |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Sctr |
| UniProt_ID | P23811 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Glycosylated cyclic WDN |
|---|---|
| Peptide_Sequence | WDX |
| Peptide_Length | 3 |
| Peptide_SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O |
| Chemical_Modification | X3=Ac3AcNH-Beta-Glc |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 376.37 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.33333 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | -1.00157 |
| Isoelectric_Point | 3.74999 |
|---|---|
| Hydrogen_Bond_Acceptors | 5 |
| Hydrogen_Bond_Donors | 6 |
| Topological_Polar_Surface_Area | 174.61000 |
| X_logP_energy | -0.80200 |
Interaction Information
| Affinity | EC50=71.6 uM |
|---|---|
| Affinity_Assay | cAMP accumulation assay |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Exploration of the Endogenous Agonist Mechanism for Activation of Secretin and VPAC1 Receptors Using Synthetic Glycosylated Peptides |
| Release_Year | 2008 |
| PMID | 18409024 |
| DOI | 10.1007/s12031-008-9058-6 |