PPIRE19298
Target Protein Information
| Protein_Name | Neuropeptide FF receptor 1 |
|---|---|
| Protein_Sequence | MEGEPSQPPNSSWPLSQNGTNTEATPATNLTFSSYYQHTSPVAAMFIVAYALIFLLCMVGNTLVCFIVLKNRHMHTVTNMFILNLAVSDLLVGIFCMPTTLVDNLITGWPFDNATCKMSGLVQGMSVSASVFTLVAIAVERFRCIVHPFREKLTLRKALVTIAVIWALALLIMCPSAVTLTVTREEHHFMVDARNRSYPLYSCWEAWPEKGMRRVYTTVLFSHIYLAPLALIVVMYARIARKLCQAPGPAPGGEEAADPRASRRRARVVHMLVMVALFFTLSWLPLWALLLLIDYGQLSAPQLHLVTVYAFPFAHWLAFFNSSANPIIYGYFNENFRRGFQAAFRARLCPRPSGSHKEAYSERPGGLLHRRVFVVVRPSDSGLPSESGPSSGAPRPGRLPLRNGRVAHHGLPREGPGCSHLPLTIPAWDI |
| Organism_Source | Homo sapiens |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | NPFFR1 |
| UniProt_ID | Q9GZQ6 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | FFRFamide radioligand |
|---|---|
| Peptide_Sequence | FFRF |
| Peptide_Length | 4 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 615.73 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.75000 |
| Average_Rotatable_Bonds | 4.25000 |
| Charge_at_pH_7 | 0.99798 |
| Isoelectric_Point | 10.55000 |
|---|---|
| Hydrogen_Bond_Acceptors | 6 |
| Hydrogen_Bond_Donors | 8 |
| Topological_Polar_Surface_Area | 212.52000 |
| X_logP_energy | 0.84407 |
Interaction Information
| Affinity | KD=1 nM |
|---|---|
| Affinity_Assay | saturation binding assay |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Endogenous mammalian RF-amide peptides including PrRP kisspeptin and 26RFa modulate nociception and morphine analgesia via NPFF receptors |
| Release_Year | 2013 |
| PMID | 23911743 |
| DOI | 10.1016/j.neuropharm.2013.07.012 |