PPIPT00569
Target Protein Information
| Protein_Name | Protein E7 |
|---|---|
| Protein_Sequence | MHGPKATLQDIVLHLEPQNEIPVDLLCHEQLSDSEEENDEIDGVNHQHLPARRAEPQRHTMLCMCCKCEARIKLVVESSADDLRAFQQLFLNTLSFVCPWCASQQ |
| Organism_Source | Human papillomavirus type 18 |
| Functional_Classification | Viral oncoprotein (cell cycle regulator) |
| Cellular_Localization | Nucleus |
| Gene_Names | E7 |
| UniProt_ID | P06788 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | p107 9mer peptide |
|---|---|
| Peptide_Sequence | LCAFYIMAK |
| Peptide_Length | 9 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](C)NC(=O)[C@H](CS)NC(=O)[C@@H](N)CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1059.35 |
|---|---|
| Aliphatic_Index | 108.88889 |
| Aromaticity | 0.22222 |
| Average_Rotatable_Bonds | 3.66667 |
| Charge_at_pH_7 | 0.93486 |
| Isoelectric_point | 8.52294 |
|---|---|
| Hydrogen_Bond_Acceptors | 14 |
| Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 342.37000 |
| X_logP_energy | 0.41160 |
Interaction Information
| Affinity | KD=1 nM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Patent |
|---|---|
| Title | Peptide inhibitors of the p33cdk2 and p34cdc2 cell cycle regulatory kinases and human papillomavirus E7 oncoprotein |
| Release_Year | 1995 |
| Patent_ID | EP0666270A2 |