PPIPT01463
Target Protein Information
| Protein_Name | RAC-alpha serine/threonine-protein kinase |
|---|---|
| Protein_Sequence | MSDVAIVKEGWLHKRGEYIKTWRPRYFLLKNDGTFIGYKERPQDVDQREAPLNNFSVAQCQLMKTERPRPNTFIIRCLQWTTVIERTFHVETPEEREEWTTAIQTVADGLKKQEEEEMDFRSGSPSDNSGAEEMEVSLAKPKHRVTMNEFEYLKLLGKGTFGKVILVKEKATGRYYAMKILKKEVIVAKDEVAHTLTENRVLQNSRHPFLTALKYSFQTHDRLCFVMEYANGGELFFHLSRERVFSEDRARFYGAEIVSALDYLHSEKNVVYRDLKLENLMLDKDGHIKITDFGLCKEGIKDGATMKTFCGTPEYLAPEVLEDNDYGRAVDWWGLGVVMYEMMCGRLPFYNQDHEKLFELILMEEIRFPRTLGPEAKSLLSGLLKKDPKQRLGGGSEDAKEIMQHRFFAGIVWQHVYEKKLSPPFKPQVTSETDTRYFDEEFTAQMITITPPDQDDSMECVDSERRPHFPQFSYSASGTA |
| Organism_Source | Homo sapiens |
| Functional_Classification | Serine/threonine kinase |
| Cellular_Localization | Cytoplasm |
| Gene_Names | AKT1 |
| UniProt_ID | P31749 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | PTR 6252 |
|---|---|
| Peptide_Sequence | rrrrrrrRPRXYXX |
| Peptide_Length | 14 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)NCC(=O)O |
| Chemical_Modification | X4=Nva;X6=Dap;X7=Hol |
| Cyclization_Method | None |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | (DArg)7 |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1855.15 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.07143 |
| Average_Rotatable_Bonds | 4.57143 |
| Charge_at_pH_7 | 8.99710 |
| Isoelectric_point | 13.04440 |
|---|---|
| Hydrogen_Bond_Acceptors | 25 |
| Hydrogen_Bond_Donors | 42 |
| Topological_Polar_Surface_Area | 1010.16000 |
| X_logP_energy | -13.58117 |
Interaction Information
| Affinity | IC50=0.8 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Patent |
|---|---|
| Title | Cell permeable conjugates of peptides for inhibition of protein kinases |
| Release_Year | 2007 |
| Patent_ID | US20070078092A1 |