PPIPT01871
Target Protein Information
| Protein_Name | T-cell surface glycoprotein CD4 |
|---|---|
| Protein_Sequence | MNRGVPFRHLLLVLQLALLPAATQGKKVVLGKKGDTVELTCTASQKKSIQFHWKNSNQIKILGNQGSFLTKGPSKLNDRADSRRSLWDQGNFPLIIKNLKIEDSDTYICEVEDQKEEVQLLVFGLTANSDTHLLQGQSLTLTLESPPGSSPSVQCRSPRGKNIQGGKTLSVSQLELQDSGTWTCTVLQNQKKVEFKIDIVVLAFQKASSIVYKKEGEQVEFSFPLAFTVEKLTGSGELWWQAERASSSKSWITFDLKNKEVSVKRVTQDPKLQMGKKLPLHLTLPQALPQYAGSGNLTLALEAKTGKLHQEVNLVVMRATQLQKNLTCEVWGPTSPKLMLSLKLENKEAKVSKREKAVWVLNPEAGMWQCLLSDSGQVLLESNIKVLPTWSTPVQPMALIVLGGVAGLLLFIGLGIFFCVRCRHRRRQAERMSQIKRLLSEKKTCQCPHRFQKTCSPI |
| Organism_Source | Homo sapiens |
| Functional_Classification | T-cell co-receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | CD4 |
| UniProt_ID | P01730 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | D-AlaPeptide T-Amide |
|---|---|
| Peptide_Sequence | aSTTTNYT |
| Peptide_Length | 8 |
| Peptide_SMILES | C[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)O)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 857.87 |
|---|---|
| Aliphatic_Index | 12.50000 |
| Aromaticity | 0.12500 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | -0.00287 |
| Isoelectric_point | 6.09320 |
|---|---|
| Hydrogen_Bond_Acceptors | 16 |
| Hydrogen_Bond_Donors | 16 |
| Topological_Polar_Surface_Area | 431.49000 |
| X_logP_energy | -7.84900 |
Interaction Information
| Affinity | IC50=0.1 nM |
|---|---|
| Affinity_Assay | radioligand competition binding assay |
| PDB_ID | None |
| Type | Antagonist |
| Structure | |
Reference Information
| Document_Type | Patent |
|---|---|
| Title | Synthetic peptides related to the HIV glycoprotein gp120 |
| Release_Year | 1987 |
| Patent_ID | EP0249390A2 |