PPIPT02256
Target Protein Information
| Protein_Name | T-cell surface glycoprotein CD4 |
|---|---|
| Protein_Sequence | MCRGFSFRHLLPLLLLQLSKLLVVTQGKTVVLGKEGGSAELPCESTSRRSASFAWKSSDQKTILGYKNKLLIKGSLELYSRFDSRKNAWERGSFPLIINKLRMEDSQTYVCELENKKEEVELWVFRVTFNPGTRLLQGQSLTLILDSNPKVSDPPIECKHKSSNIVKDSKAFSTHSLRIQDSGIWNCTVTLNQKKHSFDMKLSVLGFASTSITAYKSEGESAEFSFPLNLGEESLQGELRWKAEKAPSSQSWITFSLKNQKVSVQKSTSNPKFQLSETLPLTLQIPQVSLQFAGSGNLTLTLDRGILYQEVNLVVMKVTQPDSNTLTCEVMGPTSPKMRLILKQENQEARVSRQEKVIQVQAPEAGVWQCLLSEGEEVKMDSKIQVLSKGLNQTMFLAVVLGSAFSFLVFTGLCILFCVRCRHQQRQAARMSQIKRLLSEKKTCQCSHRMQKSHNLI |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | Ig superfamily co-receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Cd4 |
| UniProt_ID | P05540 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | pentapeptide II (Thr-Thr-Ser-Tyr-Thr) |
|---|---|
| Peptide_Sequence | TTSYT |
| Peptide_Length | 5 |
| Peptide_SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | none |
| Linear/Cyclic | Linear |
| N-terminal_Modification | free |
| C-terminal_Modification | free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 571.58 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.20000 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | -0.00287 |
| Isoelectric_point | 6.09320 |
|---|---|
| Hydrogen_Bond_Acceptors | 11 |
| Hydrogen_Bond_Donors | 11 |
| Topological_Polar_Surface_Area | 280.87000 |
| X_logP_energy | -4.57950 |
Interaction Information
| Affinity | IC50=0.4 nM |
|---|---|
| Affinity_Assay | radioligand binding assay |
| PDB_ID | None |
| Type | Antagonist |
| Structure | |
Reference Information
| Document_Type | Patent |
|---|---|
| Title | Small peptides which inhibit binding to T-8 receptors and act as immunogens |
| Release_Year | 1987 |
| Patent_ID | EP0249394A2 |