PPIPT02572
Target Protein Information
| Protein_Name | POTE ankyrin domain family member D |
|---|---|
| Protein_Sequence | MVAEVCSMPTASTVKKPFDLRSKMGKWCHHRFPCCRGSGKSNMGTSGDHDDSFMKMLRSKMGKCCRHCFPCCRGSGTSNVGTSGDHENSFMKMLRSKMGKWCCHCFPCCRGSGKSNVGAWGDYDHSAFMEPRYHIRREDLDKLHRAAWWGKVPRKDLIVMLRDTDMNKRDKEKRTALHLASANGNSEVVQLLLDRRCQLNVLDNKKRTALIKAIQCQEDECVLMLLEHGADRNIPDEYGNTALHYAIYNEDKLMAKALLLYGADIESKNKCGLTPLLLGVHEQKQQVVKFLIKKKANLNVLDRYGRTALILAVCCGSASIVNLLLEQNVDVSSQDLSGQTAREYAVSSHHHVICELLSDYKEKQMLKISSENSNPEQDLKLTSEEESQRLKVSENSQPEKMSQEPEINKDCDREVEEEIKKHGSNPVGLPENLTNGASAGNGDDGLIPQRRSRKPENQQFPDTENEEYHSDEQNDTRKQLSEEQNTGISQDEILTNKQKQIEVAEQKMNSELSLSHKKEEDLLRENSVLQEEIAMLRLELDETKHQNQLRENKILEEIESVKEKTDKLLRAMQLNEEALTKTNI |
| Organism_Source | Homo sapiens |
| Functional_Classification | Ankyrin repeat-containing protein |
| Cellular_Localization | Cytoplasm |
| Gene_Names | POTED |
| UniProt_ID | Q86YR6 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | POTE222-230 |
|---|---|
| Peptide_Sequence | WLMLLEHGA |
| Peptide_Length | 9 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)NCC(=O)N[C@@H](C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | none |
| Linear/Cyclic | Linear |
| N-terminal_Modification | free |
| C-terminal_Modification | free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1069.29 |
|---|---|
| Aliphatic_Index | 141.11111 |
| Aromaticity | 0.11111 |
| Average_Rotatable_Bonds | 3.66667 |
| Charge_at_pH_7 | -0.90933 |
| Isoelectric_point | 5.36351 |
|---|---|
| Hydrogen_Bond_Acceptors | 13 |
| Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 377.89000 |
| X_logP_energy | 0.37400 |
Interaction Information
| Affinity | IC50=42.4 uM |
|---|---|
| Affinity_Assay | T2 binding assay |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Patent |
|---|---|
| Title | Immunogenic pote peptides and methods of use |
| Release_Year | 2015 |
| Patent_ID | US20150010590A1 |