PPIPT02622
Target Protein Information
| Protein_Name | Tumor necrosis factor ligand superfamily member 13B |
|---|---|
| Protein_Sequence | MDDSTEREQSRLTSCLKKREEMKLKECVSILPRKESPSVRSSKDGKLLAATLLLALLSCCLTVVSFYQVAALQGDLASLRAELQGHHAEKLPAGAGAPKAGLEEAPAVTAGLKIFEPPAPGEGNSSQNSRNKRAVQGPEETVTQDCLQLIADSETPTIQKGSYTFVPWLLSFKRGSALEEKENKILVKETGYFFIYGQVLYTDKTYAMGHLIQRKKVHVFGDELSLVTLFRCIQNMPETLPNNSCYSAGIAKLEEGDELQLAIPRENAQISLDGDVTFFGALKLL |
| Organism_Source | Homo sapiens |
| Functional_Classification | TNF ligand superfamily |
| Cellular_Localization | Extracellular |
| Gene_Names | TNFSF13B |
| UniProt_ID | Q9Y275 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | AGP3 peptibody |
|---|---|
| Peptide_Sequence | FHDCKWDLLTKQWVCHGL |
| Peptide_Length | 18 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)CNC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CS)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](N)Cc1ccccc1)[C@@H](C)O)C(C)C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | none |
| Linear/Cyclic | Linear |
| N-terminal_Modification | free |
| C-terminal_Modification | free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2229.60 |
|---|---|
| Aliphatic_Index | 81.11111 |
| Aromaticity | 0.16667 |
| Average_Rotatable_Bonds | 3.88889 |
| Charge_at_pH_7 | 0.05616 |
| Isoelectric_point | 7.41891 |
|---|---|
| Hydrogen_Bond_Acceptors | 29 |
| Hydrogen_Bond_Donors | 31 |
| Topological_Polar_Surface_Area | 836.92000 |
| X_logP_energy | -3.59880 |
Interaction Information
| Affinity | KD=4 pM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | None |
| Type | Antagonist |
| Structure | |
Reference Information
| Document_Type | Patent |
|---|---|
| Title | Peptides and related molecules that bind to tall-1 |
| Release_Year | 2011 |
| Patent_ID | EP2292655A1 |