PPIRE00046
Target Protein Information
| Protein_Name | Dipeptidyl peptidase 1 |
|---|---|
| Protein_Sequence | MGPWSGSRLVALLLLVYGAGSVRGDTPANCTYPDLLGTWVFQVGSSGSQRDVNCSVMGPPEKKVVVHLKKLDTAYDDFGNSGHFTIIYNQGFEIVLNDYKWFAFFKYKEEGGKVTSYCHETMTGWVHDVLGRNRACFTGRKTGNTSENVNVNTARLAGLEETYSNRLYRYNHDFVKAINAIQKSWTAAPYMEYETLTLKEMIRRGGGHSRRIPRPKPAPITAEIQKKILHLPTSWDWRNVHGINFVTPVRNQGSCGSCYSFASMGMMEARIRILTNNTQTPILSPQEVVSCSQYAQGCEGGFPYLIAGKYAQDFGLVEEDCFPYTGTDSPCRLKEGCFRYYSSEYHYVGGFYGGCNEALMKLELVHQGPMAVAFEVYDDFLHYRKGVYHHTGLRDPFNPFELTNHAVLLVGYGTDAASGLDYWIVKNSWGTSWGENGYFRIRRGTDECAIESIALAATPIPKL |
| Organism_Source | Bos taurus |
| Functional_Classification | Protease |
| Cellular_Localization | Lysosome |
| Gene_Names | CTSC |
| UniProt_ID | Q3ZCJ8 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Ac-(R)9-NH2 |
|---|---|
| Peptide_Sequence | RRRRRRRRR |
| Peptide_Length | 9 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1423.70 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 5.88889 |
| Charge_at_pH_7 | 8.99795 |
| Isoelectric_Point | 13.40310 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 19 |
| Number_of_Hydrogen_Bond_Donors | 37 |
| Topological_Polar_Surface_Area | 853.22000 |
| X_logP_energy | -11.35387 |
Interaction Information
| Affinity | IC50=1.9 nM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Arginine-based structures are specific inhibitors of cathepsin C. Application of peptide combinatorial libraries. |
| Release_Year | 2000 |
| PMID | 10824120 |
| DOI | 10.1046/j.1432-1327.2000.01364.x |