PPIRE01256
Target Protein Information
| Protein_Name | CCR4-NOT transcription complex subunit 9 |
|---|---|
| Protein_Sequence | MSAQPSPHMNPQQQQQQQQQQQQTEQEKVYQWINELAHPDTRETALLELSKKRETDLAPMLWNSFGTACALLQEIVNIYPSITPPTLTAHQSNRVCNALALLQCVASHPETRTAFLQAQIPLYLYPFLSTTSKTRPFEYLRLTSLGVIGALVKTDEQEVITFLLTTEIVPLCLSIMDSGSELSKTVATFIIQKILLDESGLSYICQTYERFSHVAITLGKMVIQLAKDPCARLLKHVVRCYLRLSDNTRARKALGQCLPDQLRDGTFALCLQEDKSTKQWLQMLLKNLELGATPQQIGMSPLGS |
| Organism_Source | Drosophila melanogaster |
| Functional_Classification | deadenylase complex subunit |
| Cellular_Localization | Cytoplasm |
| Gene_Names | Rcd-1 |
| UniProt_ID | Q7JVP2 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Bam CBM |
|---|---|
| Peptide_Sequence | FEGGIDSGMMLQLEKNLVDIVDPDD |
| Peptide_Length | 25 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)CNC(=O)CNC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O)C(C)C)[C@@H](C)CC)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2751.07 |
|---|---|
| Aliphatic_Index | 101.20000 |
| Aromaticity | 0.04000 |
| Average_Rotatable_Bonds | 3.76000 |
| Charge_at_pH_7 | -5.99653 |
| Isoelectric_Point | 3.42377 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 39 |
| Number_of_Hydrogen_Bond_Donors | 36 |
| Topological_Polar_Surface_Area | 1146.46000 |
| X_logP_energy | -9.90940 |
Interaction Information
| Affinity | KD=183 nM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 5ONB |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Drosophila Bag-of-marbles directly interacts with the CAF40 subunit of the CCR4-NOT complex to elicit repression of mRNA targets. |
| Release_Year | 2017 |
| PMID | 29255063 |
| DOI | 10.1261/rna.064584.117 |