PPIRE01301
Target Protein Information
| Protein_Name | N-alpha-acetyltransferase 60 |
|---|---|
| Protein_Sequence | MTEVVPSSALSEVSLRLLCHDDIDTVKHLCGDWFPIEYPDSWYRDITSNKKFFSLAATYRGAIVGMIVAEIKNRTKIHKEDGDILASNFSVDTQVAYILSLGVVKEFRKHGIGSLLLESLKDHISTTAQDHCKAIYLHVLTTNNTAINFYENRDFKQHHYLPYYYSIRGVLKDGFTYVLYINGGHPPWTILDYIQHLGSALASLSPCSIPHRVYRQAHSLLCSFLPWSGISSKSGIEYSRTM |
| Organism_Source | Homo sapiens |
| Functional_Classification | N-terminal acetyltransferases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | NAA60 |
| UniProt_ID | Q9H7X0 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | CoA-Ac-MAPL7 |
|---|---|
| Peptide_Sequence | MAPLDLD |
| Peptide_Length | 7 |
| Peptide_SMILES | CSCC[C@H](N)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Coa-Peptide Conjugate |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 773.90 |
|---|---|
| Aliphatic_Index | 125.71429 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.28571 |
| Charge_at_pH_7 | -2.00112 |
| Isoelectric_Point | 3.49188 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 11 |
| Number_of_Hydrogen_Bond_Donors | 9 |
| Topological_Polar_Surface_Area | 303.73000 |
| X_logP_energy | -1.37210 |
Interaction Information
| Affinity | IC50=1 mM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Crystal Structure of the Golgi-Associated Human NAlpha-Acetyltransferase 60 Reveals the Molecular Determinants for Substrate-Specific Acetylation. |
| Release_Year | 2016 |
| PMID | 27320834 |
| DOI | 10.1016/j.str.2016.04.020 |