PPIRE01910
Target Protein Information
| Protein_Name | Interleukin-7 receptor subunit alpha |
|---|---|
| Protein_Sequence | MTILGTTFGMVFSLLQVVSGESGYAQNGDLEDAELDDYSFSCYSQLEVNGSQHSLTCAFEDPDVNITNLEFEICGALVEVKCLNFRKLQEIYFIETKKFLLIGKSNICVKVGEKSLTCKKIDLTTIVKPEAPFDLSVVYREGANDFVVTFNTSHLQKKYVKVLMHDVAYRQEKDENKWTHVNLSSTKLTLLQRKLQPAAMYEIKVRSIPDHYFKGFWSEWSPSYYFRTPEINNSSGEMDPILLTISILSFFSVALLVILACVLWKKRIKPIVWPSLPDHKKTLEHLCKKPRKNLNVSFNPESFLDCQIHRVDDIQARDEVEGFLQDTFPQQLEESEKQRLGGDVQSPNCPSEDVVITPESFGRDSSLTCLAGNVSACDAPILSSSRSLDCRESGKNGPHVYQDLLLSLGTTNSTLPPPFSLQSGILTLNPVAQGQPILTSLGSNQEEAYVTMSSFYQNQ |
| Organism_Source | Homo sapiens |
| Functional_Classification | receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | IL7R |
| UniProt_ID | P16871 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | P258 |
|---|---|
| Peptide_Sequence | ASACPPH |
| Peptide_Length | 7 |
| Peptide_SMILES | C[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CS)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 681.76 |
|---|---|
| Aliphatic_Index | 28.57143 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.14286 |
| Charge_at_pH_7 | 0.02692 |
| Isoelectric_Point | 7.35903 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 11 |
| Number_of_Hydrogen_Bond_Donors | 9 |
| Topological_Polar_Surface_Area | 269.25000 |
| X_logP_energy | -3.75280 |
Interaction Information
| Affinity | KD=600 nM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Screening for peptides targeted to IL-7RAlpha for molecular imaging of rheumatoid arthritis synovium. |
| Release_Year | 2016 |
| PMID | 27729062 |
| DOI | 10.1186/s13075-016-1133-8 |