PPIRE02014
Target Protein Information
| Protein_Name | Replication protein A 32 kDa subunit |
|---|---|
| Protein_Sequence | MWNSGFESYGSSSYGGAGGYTQSPGGFGSPAPSQAEKKSRARAQHIVPCTISQLLSATLVDEVFRIGNVEISQVTIVGIIRHAEKAPTNIVYKIDDMTAAPMDVRQWVDTDDTSSENTVVPPETYVKVAGHLRSFQNKKSLVAFKIMPLEDMNEFTTHILEVINAHMVLSKANSQPSAGRAPISNPGMSEAGNFGGNSFMPANGLTVAQNQVLNLIKACPRPEGLNFQDLKNQLKHMSVSSIKQAVDFLSNEGHIYSTVDDDHFKSTDAE |
| Organism_Source | Homo sapiens |
| Functional_Classification | other |
| Cellular_Localization | Nucleus |
| Gene_Names | RPA2 |
| UniProt_ID | P15927 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Tipin_195-210 |
|---|---|
| Peptide_Sequence | LTEEQQQRIERNKQLALERRQAKLLS |
| Peptide_Length | 26 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC(C)C)[C@@H](C)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 3179.63 |
|---|---|
| Aliphatic_Index | 97.69231 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.53846 |
| Charge_at_pH_7 | 2.00448 |
| Isoelectric_Point | 10.74594 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 45 |
| Number_of_Hydrogen_Bond_Donors | 53 |
| Topological_Polar_Surface_Area | 1538.66000 |
| X_logP_energy | -16.81902 |
Interaction Information
| Affinity | KD=3.1 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure of RPA32 bound to the N-terminus of SMARCAL1 redefines the binding interface between RPA32 and its interacting proteins. |
| Release_Year | 2014 |
| PMID | 24910198 |
| DOI | 10.1111/febs.12867 |