PPIRE02026
Target Protein Information
| Protein_Name | Gag polyprotein |
|---|---|
| Protein_Sequence | MARELNPLQLQQLYINNGLQPNPGHGDIIAVRFTGGPWGPGDRWARVTIRLQDNTGQPLQVPGYDLEPGIINLREDILIAGPYNLIRTAFLDLEPARGPERHGPFGDGRLQPGDGLSEGFQPITDEEIQAEVGTIGAARNEIRLLREALQRLQAGGVGRPIPGAVLQPQPVIGPVIPINHLRSVIGNTPPNPRDVALWLGRSTAAIEGVFPIVDQVTRMRVVNALVASHPGLTLTENEAGSWNAAISALWRKAHGAAAQHELAGVLSDINKKEGIQTAFNLGMQFTDGNWSLVWGIIRTLLPGQALVTNAQSQFDLMGDDIQRAENFPRVINNLYTMLGLNIHGQSIRPRVQTQPLQTRPRNPGRSQQGQLNQPRPQNRANQSYRPPRQQQQHSDVPEQRDQRGPSQPPRGSGGGYNFRRNPQQPQRYGQGPPGPNPYRRFGDGGNPQQQGPPPNRGPDQGPRPGGNPRGGGRGQGPRNGGGSAAAVHTVKASENETKNGSAEAVDGGKKGGKD |
| Organism_Source | Feline foamy virus |
| Functional_Classification | Viral envelope proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | gag |
| UniProt_ID | O56860 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | CAC1 |
|---|---|
| Peptide_Sequence | EQASQEVKNWMTETLLVQNA |
| Peptide_Length | 20 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CCC(=O)O)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C)C(=O)O)C(C)C)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2319.57 |
|---|---|
| Aliphatic_Index | 78.00000 |
| Aromaticity | 0.05000 |
| Average_Rotatable_Bonds | 3.95000 |
| Charge_at_pH_7 | -1.99699 |
| Isoelectric_Point | 3.98005 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 34 |
| Number_of_Hydrogen_Bond_Donors | 34 |
| Topological_Polar_Surface_Area | 1046.07000 |
| X_logP_energy | -11.44480 |
Interaction Information
| Affinity | KD=43 uM |
|---|---|
| Affinity_Assay | NMR chemical shift perturbation |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The dimerization domain of the HIV-1 capsid protein binds a capsid protein-derived peptide: a biophysical characterization. |
| Release_Year | 2004 |
| PMID | 15152086 |
| DOI | 10.1110/ps.03555304 |