PPIRE02042
Target Protein Information
| Protein_Name | Protein C |
|---|---|
| Protein_Sequence | MMASILLTLFRRTKKKYRRHTDDQVFNNPASKIKQKPGKIFCSAPVENLNKLRGECLRMMEMLKEETWRIYPVLLPQMELLERECRTPVTGQKVQMTYNWTQWLQTLYTMIMEENVPDMDLLQALREGGVITHQEQTMGMYVLYLMQRCCPMLPKLQFLKKIGKLI |
| Organism_Source | Nipah virus |
| Functional_Classification | Viral envelope proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | P/V/C |
| UniProt_ID | Q997F1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | SL175 |
|---|---|
| Peptide_Sequence | GWAGWLLSPRGSRPS |
| Peptide_Length | 15 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1626.84 |
|---|---|
| Aliphatic_Index | 58.66667 |
| Aromaticity | 0.13333 |
| Average_Rotatable_Bonds | 3.06667 |
| Charge_at_pH_7 | 1.99798 |
| Isoelectric_Point | 12.50011 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 21 |
| Number_of_Hydrogen_Bond_Donors | 25 |
| Topological_Polar_Surface_Area | 669.21000 |
| X_logP_energy | -6.84436 |
Interaction Information
| Affinity | IC50=21.9 uM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Peptide inhibitors of hepatitis C virus core oligomerization and virus production. |
| Release_Year | 2009 |
| PMID | 19264632 |
| DOI | 10.1099/vir.0.008565-0 |