PPIRE02294
Target Protein Information
| Protein_Name | Myc proto-oncogene protein |
|---|---|
| Protein_Sequence | MDFFRVVENQQPPATMPLNVSFTNRNYDLDYDSVQPYFYCDEEENFYQQQQQSELQPPAPSEDIWKKFELLPTPPLSPSRRSGLCSPSYVAVTPFSLRGDNDGGGGSFSTADQLEMVTELLGGDMVNQSFICDPDDETFIKNIIIQDCMWSGFSAAAKLVSEKLASYQAARKDSGSPNPARGHSVCSTSSLYLQDLSAAASECIDPSVVFPYPLNDSSSPKSCASQDSSAFSPSSDSLLSSTESSPQGSPEPLVLHEETPPTTSSDSEEEQEDEEEIDVVSVEKRQAPGKRSESGSPSAGGHSKPPHSPLVLKRCHVSTHQHNYAAPPSTRKDYPAAKRVKLDSVRVLRQISNNRKCTSPRSSDTEENVKRRTHNVLERQRRNELKRSFFALRDQIPELENNEKAPKVVILKKATAYILSVQAEEQKLISEEDLLRKRREQLKHKLEQLRNSCA |
| Organism_Source | Homo sapiens |
| Functional_Classification | Transcriptional regulator |
| Cellular_Localization | Nucleus |
| Gene_Names | MYC |
| UniProt_ID | P01106 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Nu peptide |
|---|---|
| Peptide_Sequence | NLEKKKPG |
| Peptide_Length | 8 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CC(N)=O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)NCC(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 913.08 |
|---|---|
| Aliphatic_Index | 48.75000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.12500 |
| Charge_at_pH_7 | 1.99887 |
| Isoelectric_Point | 10.50692 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 14 |
| Number_of_Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 416.68000 |
| X_logP_energy | -3.89720 |
Interaction Information
| Affinity | KD=0.1277 uM |
|---|---|
| Affinity_Assay | NMR chemical shift perturbation |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural analysis of peptide identified from the 2KRR domain of the nucleolin protein with a c-Myc G4 structure using biophysical and biochemical methods. |
| Release_Year | 2024 |
| PMID | 39035713 |
| DOI | 10.1039/d4ra02785j |