PPIRE02538
Target Protein Information
| Protein_Name | Protein C |
|---|---|
| Protein_Sequence | MMASILLTLFRRTKKKYRRHTDDQVFNNPASKIKQKPGKIFCSAPVENLNKLRGECLRMMEMLKEETWRIYPVLLPQMELLERECRTPVTGQKVQMTYNWTQWLQTLYTMIMEENVPDMDLLQALREGGVITHQEQTMGMYVLYLMQRCCPMLPKLQFLKKIGKLI |
| Organism_Source | Nipah virus |
| Functional_Classification | Viral envelope proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | P/V/C |
| UniProt_ID | Q997F1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | None |
|---|---|
| Peptide_Sequence | WSFFSNI |
| Peptide_Length | 7 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 900.00 |
|---|---|
| Aliphatic_Index | 55.71429 |
| Aromaticity | 0.42857 |
| Average_Rotatable_Bonds | 3.57143 |
| Charge_at_pH_7 | -0.00202 |
| Isoelectric_Point | 6.10000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 11 |
| Number_of_Hydrogen_Bond_Donors | 12 |
| Topological_Polar_Surface_Area | 337.26000 |
| X_logP_energy | -1.57740 |
Interaction Information
| Affinity | KD=18.5 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Interactions of hepatitis B core antigen and peptide inhibitors. |
| Release_Year | 2007 |
| PMID | 17918821 |
| DOI | 10.1021/jm070468d |