PPIRE03393
Target Protein Information
| Protein_Name | Interleukin-1 receptor type 1 |
|---|---|
| Protein_Sequence | MENMKVLLGLICLMVPLLSLEIDVCTEYPNQIVLFLSVNEIDIRKCPLTPNKMHGDTIIWYKNDSKTPISADRDSRIHQQNEHLWFVPAKVEDSGYYYCIVRNSTYCLKTKVTVTVLENDPGLCYSTQATFPQRLHIAGDGSLVCPYVSYFKDENNELPEVQWYKNCKPLLLDNVSFFGVKDKLLVRNVAEEHRGDYICRMSYTFRGKQYPVTRVIQFITIDENKRDRPVILSPRNETIEADPGSMIQLICNVTGQFSDLVYWKWNGSEIEWNDPFLAEDYQFVEHPSTKRKYTLITTLNISEVKSQFYRYPFICVVKNTNIFESAHVQLIYPVPDFKNYLIGGFIILTATIVCCVCIYKVFKVDIVLWYRDSCSGFLPSKASDGKTYDAYILYPKTLGEGSFSDLDTFVFKLLPEVLEGQFGYKLFIYGRDDYVGEDTIEVTNENVKKSRRLIIILVRDMGGFSWLGQSSEEQIAIYNALIQEGIKIVLLELEKIQDYEKMPDSIQFIKQKHGVICWSGDFQERPQSAKTRFWKNLRYQMPAQRRSPLSKHRLLTLDPVRDTKEKLPAATHLPLG |
| Organism_Source | Mus musculus |
| Functional_Classification | Receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Il1r1 |
| UniProt_ID | P13504 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Perthamide B |
|---|---|
| Peptide_Sequence | NXXXXXXX |
| Peptide_Length | 8 |
| Peptide_SMILES | NC(=O)C[C@H](N)C(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)O |
| Chemical_Modification | X2=3-amino-2-hydroxy-6-methyloctanoic acid; X3=octanoic acid; X4=23-dehydro-2-aminobutyric acid; X5=N-methylglycine; X6=O-methylthreonine; X7=gamma-methylproline; X8=3-bromotyrosine |
| Cyclization_Method | N1<->X8, main chain cyclization, amide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 531.48 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.12500 |
| Charge_at_pH_7 | -0.00202 |
| Isoelectric_Point | 6.10000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 10 |
| Number_of_Hydrogen_Bond_Donors | 10 |
| Topological_Polar_Surface_Area | 310.11000 |
| X_logP_energy | -7.91290 |
Interaction Information
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Isolation and structure elucidation of perthamide B, a novel peptide from the sponge Theonella sp. |
| Release_Year | 1994 |
| PMID | |
| DOI | 10.1016/0040-4039(94)85012-7 |