PPIRE03751
Target Protein Information
| Protein_Name | None |
|---|---|
| Protein_Sequence | MEDKGKTFFGQPLGLSTLFMTEMWERFSYYGMRAILLYYMWFLISTGDLHITRATAASIMAIYASMVYLSGTIGGFVADRIIGARPAVFWGGVLIMLGHIVLALPFGASALFGSIILIIIGTGFLKPNVSTLVGTLYDEHDRRRDAGFSIFVFGINLGAFIAPLIVGAAQEAAGYHVAFSLAAIGMFIGLLVYYFGGKKTLDPRYLRPTDPLAPEEVKPLLVKVGLAVAGFIAVIVVMNLVGWNSLPAYINLLTIVAIAIPVFYFVWMIASVKVTATERLRVVSYIPLFIAAVLFWAIEEQGSVVLATFAAERVDSSWFPVSWFQSLNPLFIMLYTPFFAWLWTAWKKNQPSSPTKFAVGLIFAGLSFLIMAIPGALYGTSGKVSPLWLVGSWALVILGEMLISPVGLSVTTKLAPKAFNSQMMSMWFLSSAVGSALNAQLVTLYNAKSEVAYFSYFGLGSVVLGIVLVFLSKRIQGLMQGVE |
| Organism_Source | Streptococcus thermophilus |
| Functional_Classification | proton-coupled oligopeptide transporters |
| Cellular_Localization | Plasma membrane |
| Gene_Names | dtpT |
| UniProt_ID | A0A2X3WPS3 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | di-alanine |
|---|---|
| Peptide_Sequence | AA |
| Peptide_Length | 2 |
| Peptide_SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 160.17 |
|---|---|
| Aliphatic_Index | 100.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 1.50000 |
| Charge_at_pH_7 | -0.00202 |
| Isoelectric_Point | 6.10000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 3 |
| Number_of_Hydrogen_Bond_Donors | 3 |
| Topological_Polar_Surface_Area | 92.42000 |
| X_logP_energy | -1.07710 |
Interaction Information
| Affinity | IC50=37 uM |
|---|---|
| Affinity_Assay | proton-driven peptide uptake assay |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural basis for polyspecificity in the POT family of proton-coupled oligopeptide transporters. |
| Release_Year | 2014 |
| PMID | 24916388 |
| DOI | 10.15252/embr.201338403 |