PPIRE04111
Target Protein Information
| Protein_Name | Kelch domain-containing protein 2 |
|---|---|
| Protein_Sequence | MADGNEDLRADDLPGPAFESYESMELACPAERSGHVAVSDGRHMFVWGGYKSNQVRGLYDFYLPREELWIYNMETGRWKKINTEGDVPPSMSGSCAVCVDRVLYLFGGHHSRGNTNKFYMLDSRSTDRVLQWERIDCQGIPPSSKDKLGVWVYKNKLIFFGGYGYLPEDKVLGTFEFDETSFWNSSHPRGWNDHVHILDTETFTWSQPITTGKAPSPRAAHACATVGNRGFVFGGRYRDARMNDLHYLNLDTWEWNELIPQGICPVGRSWHSLTPVSSDHLFLFGGFTTDKQPLSDAWTYCISKNEWIQFNHPYTEKPRLWHTACASDEGEVIVFGGCANNLLVHHRAAHSNEILIFSVQPKSLVRLSLEAVICFKEMLANSWNCLPKHLLHSVNQRFGSNNTSGS |
| Organism_Source | Homo sapiens |
| Functional_Classification | ubiquitin ligases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | KLHDC2 |
| UniProt_ID | Q9Y2U9 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | SelK C-end degron(3 aa) |
|---|---|
| Peptide_Sequence | AGG |
| Peptide_Length | 3 |
| Peptide_SMILES | C[C@H](N)C(=O)NCC(=O)NCC(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 203.20 |
|---|---|
| Aliphatic_Index | 33.33333 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 1.66667 |
| Charge_at_pH_7 | -0.00202 |
| Isoelectric_Point | 6.10000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 4 |
| Number_of_Hydrogen_Bond_Donors | 4 |
| Topological_Polar_Surface_Area | 121.52000 |
| X_logP_energy | -2.34940 |
Interaction Information
| Affinity | IC50=233 uM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Recognition of the Diglycine C-End Degron by CRL2KLHDC2 Ubiquitin Ligase. |
| Release_Year | 2018 |
| PMID | 30526872 |
| DOI | 10.1016/j.molcel.2018.10.021 |