PPIRE04511
Target Protein Information
| Protein_Name | Protein-arginine deiminase type-4 |
|---|---|
| Protein_Sequence | MAQGTLIRVTPEQPTHAVCVLGTLTQLDICSSAPEDCTSFSINASPGVVVDIAHGPPAKKKSTGSSTWPLDPGVEVTLTMKVASGSTGDQKVQISYYGPKTPPVKALLYLTGVEISLCADITRTGKVKPTRAVKDQRTWTWGPCGQGAILLVNCDRDNLESSAMDCEDDEVLDSEDLQDMSLMTLSTKTPKDFFTNHTLVLHVARSEMDKVRVFQATRGKLSSKCSVVLGPKWPSHYLMVPGGKHNMDFYVEALAFPDTDFPGLITLTISLLDTSNLELPEAVVFQDSVVFRVAPWIMTPNTQPPQEVYACSIFENEDFLKSVTTLAMKAKCKLTICPEEENMDDQWMQDEMEIGYIQAPHKTLPVVFDSPRNRGLKEFPIKRVMGPDFGYVTRGPQTGGISGLDSFGNLEVSPPVTVRGKEYPLGRILFGDSCYPSNDSRQMHQALQDFLSAQQVQAPVKLYSDWLSVGHVDEFLSFVPAPDRKGFRLLLASPRSCYKLFQEQQNEGHGEALLFEGIKKKKQQKIKNILSNKTLREHNSFVERCIDWNRELLKRELGLAESDIIDIPQLFKLKEFSKAEAFFPNMVNMLVLGKHLGIPKPFGPVINGRCCLEEKVCSLLEPLGLQCTFINDFFTYHIRHGEVHCGTNVRRKPFSFKWWNMVP |
| Organism_Source | Homo sapiens |
| Functional_Classification | deiminases |
| Cellular_Localization | Nucleus |
| Gene_Names | PADI4 |
| UniProt_ID | Q9UM07 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Biotin-TDFA |
|---|---|
| Peptide_Sequence | TDX |
| Peptide_Length | 3 |
| Peptide_SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O |
| Chemical_Modification | X3=fluoroacetamidine |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Biotin |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 291.26 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.66667 |
| Charge_at_pH_7 | -1.00157 |
| Isoelectric_Point | 3.74999 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 6 |
| Number_of_Hydrogen_Bond_Donors | 6 |
| Topological_Polar_Surface_Area | 179.05000 |
| X_logP_energy | -3.14520 |
Interaction Information
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Synthesis and screening of a haloacetamidine containing library to identify PAD4 selective inhibitors. |
| Release_Year | 2012 |
| PMID | 22004374 |
| DOI | 10.1021/cb200258q |