PPIRE05390
Target Protein Information
| Protein_Name | DNA repair and recombination protein RadA |
|---|---|
| Protein_Sequence | MAGEEVKEIDEFEELGFEPATEETPKKKKKEKIIRSIEDLPGVGPATAEKLREAGYDTLEAIAVASPIELKEVAGISEGTALKIIQAARKAANLGTFMRADEYLKKRATIGRISTGSKSLDKLLGGGIETQAITEVFGEFGSGKTQLAHTLAVMVQLPPEEGGLNGSVIWIDTENTFRPERIREIAQNRGLDPDEVLKHIYVARAFNSNHQMLLVQQAEDKIKELLNTDRPVKLLIVDSLTSHFRSEYIGRGALAERQQKLAKHLADLHRLANLYDIAVFVTNQVQARPDAFFGDPTRPIGGHILAHSATLRVYLRKGKGGKRIARLIDAPHLPEGEAVFSITEKGIED |
| Organism_Source | Pyrococcus furiosus (strain ATCC 43587 / DSM 3638 / JCM 8422 / Vc1) |
| Functional_Classification | recombinase |
| Cellular_Localization | Cytoplasm |
| Gene_Names | radA |
| UniProt_ID | O74036 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Ac-FHTA-NH2 |
|---|---|
| Peptide_Sequence | FHTA |
| Peptide_Length | 4 |
| Peptide_SMILES | C[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](N)Cc1ccccc1)[C@@H](C)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 474.52 |
|---|---|
| Aliphatic_Index | 25.00000 |
| Aromaticity | 0.25000 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | 0.08889 |
| Isoelectric_Point | 7.55032 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 7 |
| Number_of_Hydrogen_Bond_Donors | 7 |
| Topological_Polar_Surface_Area | 199.53000 |
| X_logP_energy | -1.53810 |
Interaction Information
| Affinity | KD=250 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Using a fragment-based approach to target protein-protein interactions. |
| Release_Year | 2013 |
| PMID | 23344974 |
| DOI | 10.1002/cbic.201200521 |