PPIRE05539
Target Protein Information
| Protein_Name | Tropomyosin alpha-1 chain |
|---|---|
| Protein_Sequence | MDAIKKKMQMLKLDKENALDRAEQAEADKKAAEERSKQLEDELVALQKKLKGTEDELDKYSESLKDAQEKLELADKKATDAESEVASLNRRIQLVEEELDRAQERLATALQKLEEAEKAADESERGMKVIENRAQKDEEKMEIQEIQLKEAKHIAEEADRKYEEVARKLVIIEGDLERAEERAELSESKCAELEEELKTVTNNLKSLEAQAEKYSQKEDKYEEEIKVLTDKLKEAETRAEFAERSVTKLEKSIDDLEDELYAQKLKYKAISEELDHALNDMTSI |
| Organism_Source | Gallus gallus |
| Functional_Classification | actin-binding proteins |
| Cellular_Localization | Plasma membrane |
| Gene_Names | TPM1 |
| UniProt_ID | P04268 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | HPPHG |
|---|---|
| Peptide_Sequence | HPPHG |
| Peptide_Length | 5 |
| Peptide_SMILES | N[C@@H](Cc1c[nH]cn1)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)NCC(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 543.58 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.20000 |
| Charge_at_pH_7 | 0.17980 |
| Isoelectric_Point | 7.71436 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 8 |
| Number_of_Hydrogen_Bond_Donors | 6 |
| Topological_Polar_Surface_Area | 219.50000 |
| X_logP_energy | -2.08710 |
Interaction Information
| Affinity | IC50=242 uM |
|---|---|
| Affinity_Assay | solid-phase competition binding assay |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Peptides derived from the histidine-proline domain of the histidine-proline-rich glycoprotein bind to tropomyosin and have antiangiogenic and antitumor activities |
| Release_Year | 2004 |
| PMID | 15313924 |
| DOI | 10.1158/0008-5472.CAN-04-0440 |