PPIRE05882
Target Protein Information
| Protein_Name | Renin-1 |
|---|---|
| Protein_Sequence | MDRRRMPLWALLLLWSPCTFSLPTRTATFERIPLKKMPSVREILEERGVDMTRLSAEWGVFTKRPSLTNLTSPVVLTNYLNTQYYGEIGIGTPPQTFKVIFDTGSANLWVPSTKCSRLYLACGIHSLYESSDSSSYMENGSDFTIHYGSGRVKGFLSQDSVTVGGITVTQTFGEVTELPLIPFMLAKFDGVLGMGFPAQAVGGVTPVFDHILSQGVLKEEVFSVYYNRGSHLLGGEVVLGGSDPQHYQGNFHYVSISKTDSWQITMKGVSVGSSTLLCEEGCAVVVDTGSSFISAPTSSLKLIMQALGAKEKRIEEYVVNCSQVPTLPDISFDLGGRAYTLSSTDYVLQYPNRRDKLCTLALHAMDIPPPTGPVWVLGATFIRKFYTEFDRHNNRIGFALAR |
| Organism_Source | Mus musculus |
| Functional_Classification | aspartyl proteases |
| Cellular_Localization | Extracellular |
| Gene_Names | Ren1 |
| UniProt_ID | P06281 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | pepstatin |
|---|---|
| Peptide_Sequence | VVXAX |
| Peptide_Length | 5 |
| Peptide_SMILES | CC(C)[C@H](N)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](C)C(=O)NCC(=O)O)C(C)C |
| Chemical_Modification | X3=statine; X5=statine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Isovaleryl |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 401.46 |
|---|---|
| Aliphatic_Index | 136.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.20000 |
| Charge_at_pH_7 | -0.00202 |
| Isoelectric_Point | 6.10000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 6 |
| Number_of_Hydrogen_Bond_Donors | 6 |
| Topological_Polar_Surface_Area | 179.72000 |
| X_logP_energy | -2.06780 |
Interaction Information
| Affinity | Ki=410 nM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Synthesis of peptides related to the prosegment of mouse submaxillary gland renin precursor: an approach to renin inhibitors. |
| Release_Year | 1984 |
| PMID | 6364138 |
| DOI | 10.1073/pnas.81.1.48 |