PPIRE05938
Target Protein Information
| Protein_Name | None |
|---|---|
| Protein_Sequence | MEPAPSAGAELQPSFLPNASDAYPSTFPSAGANASGPPGTRSASSLALAIAITALYSAVCAVGLLGNVLVMFGIVRYTKLKTATNIYIFNLALADALATSTLPFQSAKYLMETWPFGELLCKAVLSIDYYNMFTSIFTLTMMSVDRYIAVCHPVKALDFRTPAKAKLINICIWVLASGVGVPIMVMAVTRPRDGAVVCMLQFPSPSWYWDTVTKICVFLFAFVVPILIITVCYGLMLLRLRSVRLLSGSKEKDRSLRRITRMVLVVVGAFVVCWAPIHIFVIVWTLVDIDRHDPFVVAALHLCIALGYANSSLNPVLYAFLDENFKRCFRQLCRSPCGRPEPSSFSRAREATARERVTACTPSDGP |
| Organism_Source | Cavia porcellus |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | OPRD1 |
| UniProt_ID | A0A286XTF2 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | D-Ala2-L-Met5-enkephalin amide |
|---|---|
| Peptide_Sequence | YaGFM |
| Peptide_Length | 5 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 587.69 |
|---|---|
| Aliphatic_Index | 20.00000 |
| Aromaticity | 0.40000 |
| Average_Rotatable_Bonds | 3.20000 |
| Charge_at_pH_7 | -0.00287 |
| Isoelectric_Point | 6.09320 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 8 |
| Number_of_Hydrogen_Bond_Donors | 7 |
| Topological_Polar_Surface_Area | 199.95000 |
| X_logP_energy | -0.06710 |
Interaction Information
| Affinity | KD=2.39 nM |
|---|---|
| Affinity_Assay | saturation radioligand binding assay |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Comparison of the binding characteristics of tritiated opiates and opioid peptides. |
| Release_Year | 1980 |
| PMID | 7437652 |
| DOI | 10.1111/j.1476-5381.1980.tb08727.x |