PPIRE06344
Target Protein Information
| Protein_Name | Growth hormone secretagogue receptor type 1 |
|---|---|
| Protein_Sequence | MWNATPSEEPEPNVTLDLDWDASPGNDSLPDELLPLFPAPLLAGVTATCVALFVVGISGNLLTMLVVSRFRELRTTTNLYLSSMAFSDLLIFLCMPLDLVRLWQYRPWNFGDLLCKLFQFVSESCTYATVLTITALSVERYFAICFPLRAKVVVTKGRVKLVILVIWAVAFCSAGPIFVLVGVEHENGTDPRDTNECRATEFAVRSGLLTVMVWVSSVFFFLPVFCLTVLYSLIGRKLWRRRGDAAVGASLRDQNHKQTVKMLAVVVFAFILCWLPFHVGRYLFSKSFEPGSLEIAQISQYCNLVSFVLFYLSAAINPILYNIMSKKYRVAVFKLLGFESFSQRKLSTLKDESSRAWTKSSINT |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Ghsr |
| UniProt_ID | O08725 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | hexarelin |
|---|---|
| Peptide_Sequence | HwAWfK |
| Peptide_Length | 6 |
| Peptide_SMILES | C[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)Cc1c[nH]cn1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 874.01 |
|---|---|
| Aliphatic_Index | 16.66667 |
| Aromaticity | 0.50000 |
| Average_Rotatable_Bonds | 3.83333 |
| Charge_at_pH_7 | 1.08860 |
| Isoelectric_Point | 9.70200 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 9 |
| Number_of_Hydrogen_Bond_Donors | 11 |
| Topological_Polar_Surface_Area | 295.10000 |
| X_logP_energy | 1.62770 |
Interaction Information
| Affinity | KD=14.5 nM |
|---|---|
| Affinity_Assay | photoaffinity labeling |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Identification and characterization of a new growth hormone-releasing peptide receptor in the heart. |
| Release_Year | 1999 |
| PMID | 10532947 |
| DOI | 10.1161/01.res.85.9.796 |