PPIRE06375
Target Protein Information
| Protein_Name | Nuclear receptor subfamily 5 group A member 2 |
|---|---|
| Protein_Sequence | MSASLDTGDFQEFLKHGLTAIASAPGSETRHSPKREEQLREKRAGLPDRHRRPIPARSRLVMLPKVETEAPGLVRSHGEQGQMPENMQVSQFKMVNYSYDEDLEELCPVCGDKVSGYHYGLLTCESCKGFFKRTVQNQKRYTCIENQNCQIDKTQRKRCPYCRFKKCIDVGMKLEAVRADRMRGGRNKFGPMYKRDRALKQQKKALIRANGLKLEAMSQVIQAMPSDLTSAIQNIHSASKGLPLSHVALPPTDYDRSPFVTSPISMTMPPHSSLHGYQPYGHFPSRAIKSEYPDPYSSSPESMMGYSYMDGYQTNSPASIPHLILELLKCEPDEPQVQAKIMAYLQQEQSNRNRQEKLSAFGLLCKMADQTLFSIVEWARSSIFFRELKVDDQMKLLQNCWSELLILDHIYRQVAHGKEGTIFLVTGEHVDYSTIISHTEVAFNNLLSLAQELVVRLRSLQFDQREFVCLKFLVLFSSDVKNLENLQLVEGVQEQVNAALLDYTVCNYPQQTEKFGQLLLRLPEIRAISKQAEDYLYYKHVNGDVPYNNLLIEMLHAKRA |
| Organism_Source | Mus musculus |
| Functional_Classification | nuclear receptors |
| Cellular_Localization | Nucleus |
| Gene_Names | Nr5a2 |
| UniProt_ID | P45448 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | SHP ID1 |
|---|---|
| Peptide_Sequence | ILYTLL |
| Peptide_Length | 6 |
| Peptide_SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 734.93 |
|---|---|
| Aliphatic_Index | 260.00000 |
| Aromaticity | 0.16667 |
| Average_Rotatable_Bonds | 3.66667 |
| Charge_at_pH_7 | -0.00287 |
| Isoelectric_Point | 6.09320 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 9 |
| Number_of_Hydrogen_Bond_Donors | 9 |
| Topological_Polar_Surface_Area | 249.28000 |
| X_logP_energy | 1.33580 |
Interaction Information
| Affinity | IC50=0.5 uM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | 1ZH7 |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural and biochemical basis for selective repression of the orphan nuclear receptor liver receptor homolog 1 by small heterodimer partner. |
| Release_Year | 2005 |
| PMID | 15976031 |
| DOI | 10.1073/pnas.0501204102 |