PPIRE06833
Target Protein Information
| Protein_Name | Proteasome subunit beta type-5 |
|---|---|
| Protein_Sequence | MALASVLERPLPVNQRGFFGLGGRADLLDLGPGSLSDGLSLAAPGWGVPEEPGIEMLHGTTTLAFKFRHGVIVAADSRATAGAYIASQTVKKVIEINPYLLGTMAGGAADCSFWERLLARQCRIYELRNKERISVAAASKLLANMVYQYKGMGLSMGTMICGWDKRGPGLYYVDSEGNRISGATFSVGSGSVYAYGVMDRGYSYDLEVEQAYDLARRAIYQATYRDAYSGGAVNLYHVREDGWIRVSSDNVADLHEKYSGSTP |
| Organism_Source | Homo sapiens |
| Functional_Classification | protease |
| Cellular_Localization | Cytoplasm |
| Gene_Names | PSMB5 |
| UniProt_ID | P28074 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | scytonemide B |
|---|---|
| Peptide_Sequence | xYDFSX |
| Peptide_Length | 6 |
| Peptide_SMILES | NCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)NCC(=O)O |
| Chemical_Modification | X1=citrulline; X6=3-hydroxyoctanoic acid |
| Cyclization_Method | Multi-point cyclization; Y2<->F4; amide bond; X6<->D3; ester bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | None |
| C-terminal_Modification | None |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 644.64 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.33333 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | -1.00242 |
| Isoelectric_Point | 3.74999 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 10 |
| Number_of_Hydrogen_Bond_Donors | 10 |
| Topological_Polar_Surface_Area | 286.58000 |
| X_logP_energy | -3.25690 |
Interaction Information
| Affinity | IC50=50 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Scytonemides A and B, cyclic peptides with 20S proteasome inhibitory activity from the cultured cyanobacterium Scytonema hofmanii. |
| Release_Year | 2010 |
| PMID | 21058727 |
| DOI | 10.1021/np100600z |