PPIRE07005
Target Protein Information
| Protein_Name | Paired immunoglobulin-like type 2 receptor alpha |
|---|---|
| Protein_Sequence | MGRPLLLPLLPLLLPPAFLQPSGSTGSGPSYLYGVTQPKHLSASMGGSVEIPFSFYYPWELATAPDVRISWRRGHFHRQSFYSTRPPSIHKDYVNRLFLNWTEGQKSGFLRISNLQKQDQSVYFCRVELDTRSSGRQQWQSIEGTKLSITQAVTTTTQRPSSMTTTWRLSSTTTTTGLRVTQGKRRSDSWHISLETAVGVAVAVTVLGIMILGLICLLRWRRRKGQQRTKATTPAREPFQNTEEPYENIRNEGQNTDPKLNPKDDGIVYASLALSSSTSPRAPPSHRPLKSPQNETLYSVLKA |
| Organism_Source | Homo sapiens |
| Functional_Classification | sialic acid-binding immunoglobulin-like lectins |
| Cellular_Localization | Plasma membrane |
| Gene_Names | PILRA |
| UniProt_ID | Q9UKJ1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | GalNAc type glycopeptide |
|---|---|
| Peptide_Sequence | GPAXPAP |
| Peptide_Length | 7 |
| Peptide_SMILES | C[C@H](NC(=O)[C@@H]1CCCN1C(=O)CN)C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O |
| Chemical_Modification | X4=Neu5Ac(alpha2-6)GalNAc |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 565.63 |
|---|---|
| Aliphatic_Index | 28.57143 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 1.42857 |
| Charge_at_pH_7 | -0.00202 |
| Isoelectric_Point | 6.10000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 8 |
| Number_of_Hydrogen_Bond_Donors | 5 |
| Topological_Polar_Surface_Area | 211.55000 |
| X_logP_energy | -2.87170 |
Interaction Information
| Affinity | KD=6.7 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 3WV0 |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural and thermodynamic analyses reveal critical features of glycopeptide recognition by the human PILRAlpha immune cell receptor. |
| Release_Year | 2017 |
| PMID | 29046357 |
| DOI | 10.1074/jbc.M117.799239 |