PPIRE07142
Target Protein Information
| Protein_Name | Importin subunit alpha-1 |
|---|---|
| Protein_Sequence | MSTNENANLPAARLNRFKNKGKDSTEMRRRRIEVNVELRKAKKDEQMLKRRNVSSFPDDATSPLQENRNNQGTVNWSVEDIVKGINSNNLESQLQATQAARKLLSREKQPPIDNIIRAGLIPKFVSFLGKTDCSPIQFESAWALTNIASGTSEQTKAVVDGGAIPAFISLLASPHAHISEQAVWALGNIAGDGSAFRDLVIKHGAIDPLLALLAVPDLSTLACGYLRNLTWTLSNLCRNKNPAPPLDAVEQILPTLVRLLHHNDPEVLADSCWAISYLTDGPNERIEMVVKKGVVPQLVKLLGATELPIVTPALRAIGNIVTGTDEQTQKVIDAGALAVFPSLLTNPKTNIQKEATWTMSNITAGRQDQIQQVVNHGLVPFLVGVLSKADFKTQKEAAWAITNYTSGGTVEQIVYLVHCGIIEPLMNLLSAKDTKIIQVILDAISNIFQAAEKLGETEKLSIMIEECGGLDKIEALQRHENESVYKASLNLIEKYFSVEEEEDQNVVPETTSEGFAFQVQDGAPGTFNF |
| Organism_Source | Mus musculus |
| Functional_Classification | nuclear transport receptor |
| Cellular_Localization | Cytoplasm |
| Gene_Names | Kpna2 |
| UniProt_ID | P52293 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | SV40 NLS(major site) |
|---|---|
| Peptide_Sequence | PKKKRKV |
| Peptide_Length | 7 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 883.15 |
|---|---|
| Aliphatic_Index | 41.42857 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.85714 |
| Charge_at_pH_7 | 4.99680 |
| Isoelectric_Point | 11.99738 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 13 |
| Number_of_Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 389.91000 |
| X_logP_energy | -2.83293 |
Interaction Information
| Affinity | KD=0.31 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural basis for the nuclear import of the human androgen receptor. |
| Release_Year | 2008 |
| PMID | 18319300 |
| DOI | 10.1242/jcs.022103 |