PPIRE07150
Target Protein Information
| Protein_Name | C3a anaphylatoxin chemotactic receptor |
|---|---|
| Protein_Sequence | MESSSAETNSTGLHLEPQYQPETILAMAILGLTFVLGLPGNGLVLWVAGLKMRRTVNTVWFLHLTVADFVCCLSLPFSMAHLALRGYWPYGEILCKFIPTVIIFNMFASVFLLTAISLDRCLMVLKPIWCQNHRNVRTACIICGCIWLVAFVLCIPVFVYRETFTLENHTICTYNFSPGSFDYLDYAYDRDAWGYGTPDPIVQLPGEMEHRSDPSSFQTQDGPWSVTTTLYSQTSQRPSEDSFHMDSAKLSGQGKYVDVVLPTNLCGLPMEENRTNTLHNAAFLSSDLDVSNATQKCLSTPEPPQDFWDDLSPFTHEYRTPRLLKVITFTRLVVGFLLPMIIMVACYTLIIFRMRRVRVVKSWNKALHLAMVVVTIFLICWAPYHVFGVLILFINPESRVGAALLSWDHVSIALASANSCFNPFLYALLGRDLRKRVRQSMKGILEAAFSEDISKSTSFIQAKAFSEKHSLSTNV |
| Organism_Source | Cavia porcellus |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | C3AR1 |
| UniProt_ID | O88680 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | PMYPLPR |
|---|---|
| Peptide_Sequence | PMYPLPR |
| Peptide_Length | 7 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@@H]1CCCN1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 873.08 |
|---|---|
| Aliphatic_Index | 55.71429 |
| Aromaticity | 0.14286 |
| Average_Rotatable_Bonds | 3.14286 |
| Charge_at_pH_7 | 0.99713 |
| Isoelectric_Point | 9.34881 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 11 |
| Number_of_Hydrogen_Bond_Donors | 10 |
| Topological_Polar_Surface_Area | 288.48000 |
| X_logP_energy | -0.24503 |
Interaction Information
| Affinity | IC50=790 uM |
|---|---|
| Affinity_Assay | radioreceptor assay |
| PDB_ID | None |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Studies on the ileum-contracting mechanisms and identification as a complement C3a receptor agonist of oryzatensin, a bioactive peptide derived from rice albumin. |
| Release_Year | 1996 |
| PMID | 8822503 |
| DOI | 10.1016/0196-9781(95)02059-4 |