PPIRE07207
Target Protein Information
| Protein_Name | Beta sliding clamp |
|---|---|
| Protein_Sequence | MKFTVEREHLLKPLQQVSGPLGGRPTLPILGNLLLQVADGTLSLTGTDLEMEMVARVALVQPHEPGATTVPARKFFDICRGLPEGAEIAVQLEGERMLVRSGRSRFSLSTLPAADFPNLDDWQSEVEFTLPQATMKRLIEATQFSMAHQDVRYYLNGMLFETEGEELRTVATDGHRLAVCSMPIGQSLPSHSVIVPRKGVIELMRMLDGGDNPLRVQIGSNNIRAHVGDFIFTSKLVDGRFPDYRRVLPKNPDKHLEAGCDLLKQAFARAAILSNEKFRGVRLYVSENQLKITANNPEQEEAEEILDVTYSGAEMEIGFNVSYVLDVLNALKCENVRMMLTDSVSSVQIEDAASQSAAYVVMPMRL |
| Organism_Source | Escherichia coli (strain K12) |
| Functional_Classification | processivity factors |
| Cellular_Localization | Cytoplasm |
| Gene_Names | dnaN |
| UniProt_ID | P0A988 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | P1 |
|---|---|
| Peptide_Sequence | RQLVLGL |
| Peptide_Length | 7 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CCCNC(=N)N)C(C)C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 798.00 |
|---|---|
| Aliphatic_Index | 208.57143 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.85714 |
| Charge_at_pH_7 | 0.99798 |
| Isoelectric_Point | 10.55000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 10 |
| Number_of_Hydrogen_Bond_Donors | 12 |
| Topological_Polar_Surface_Area | 342.91000 |
| X_logP_energy | -1.73843 |
Interaction Information
| Affinity | KD=0.29 uM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | 1OK7 |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure-based design of short peptide ligands binding onto the E. coli processivity ring. |
| Release_Year | 2011 |
| PMID | 21619076 |
| DOI | 10.1021/jm200311m |