PPIRE07225
Target Protein Information
| Protein_Name | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta |
|---|---|
| Protein_Sequence | MSAKDERAREILRGFKLNWMNLRDAETGKILWQGTEDLSVPGVEHEARVPKKILKCKAVSRELNFSSTEQMEKFRLEQKVYFKGQCLEEWFFEFGFVIPNSTNTWQSLIEAAPESQMMPASVLTGNVIIETKFFDDDLLVSTSRVRLFYV |
| Organism_Source | Homo sapiens |
| Functional_Classification | prenyl-binding proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | PDE6D |
| UniProt_ID | O43924 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Rheb(SI)(175-181) |
|---|---|
| Peptide_Sequence | SQGSSIC |
| Peptide_Length | 7 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CO)C(=O)N[C@@H](CS)C(=O)O |
| Chemical_Modification | C7=farnesyl; C7=carboxy-methylation |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | methyl ester |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 680.73 |
|---|---|
| Aliphatic_Index | 55.71429 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.14286 |
| Charge_at_pH_7 | -0.06399 |
| Isoelectric_Point | 5.92254 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 13 |
| Number_of_Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 341.70000 |
| X_logP_energy | -6.84320 |
Interaction Information
| Affinity | KD=12 nM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | PDE6Delte-mediated sorting of INPP5E into the cilium is determined by cargo-carrier affinity. |
| Release_Year | 2016 |
| PMID | 27063844 |
| DOI | 10.1038/ncomms11366 |