PPIRE08101
Target Protein Information
| Protein_Name | Tumor susceptibility gene 101 protein |
|---|---|
| Protein_Sequence | MAVSESQLKKMVSKYKYRDLTVRETVNVITLYKDLKPVLDSYVFNDGSSRELMNLTGTIPVPYRGNTYNIPICLWLLDTYPYNPPICFVKPTSSMTIKTGKHVDANGKIYLPYLHEWKHPQSDLLGLIQVMIVVFGDEPPVFSRPISASYPPYQATGPPNTSYMPGMPGGISPYPSGYPPNPSGYPGCPYPPGGPYPATTSSQYPSQPPVTTVGPSRDGTISEDTIRASLISAVSDKLRWRMKEEMDRAQAELNALKRTEEDLKKGHQKLEEMVTRLDQEVAEVDKNIELLKKKDEELSSALEKMENQSENNDIDEVIIPTAPLYKQILNLYAEENAIEDTIFYLGEALRRGVIDLDVFLKHVRLLSRKQFQLRALMQKARKTAGLSDLY |
| Organism_Source | Homo sapiens |
| Functional_Classification | ESCRT-1 complex |
| Cellular_Localization | Cytoplasm |
| Gene_Names | TSG101 |
| UniProt_ID | Q99816 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | CP11 |
|---|---|
| Peptide_Sequence | CGWIYWNV |
| Peptide_Length | 8 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@@H](N)CS)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(=O)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | Main chain-main chain cyclization; C1<->V8; amide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Tat Conjugation |
| C-terminal_Modification | None |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1040.20 |
|---|---|
| Aliphatic_Index | 85.00000 |
| Aromaticity | 0.37500 |
| Average_Rotatable_Bonds | 3.37500 |
| Charge_at_pH_7 | -0.06484 |
| Isoelectric_Point | 5.91950 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 12 |
| Number_of_Hydrogen_Bond_Donors | 14 |
| Topological_Polar_Surface_Area | 361.92000 |
| X_logP_energy | 0.32690 |
Interaction Information
| Affinity | IC50=2 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Potent Inhibition of Hepatitis E Virus Release by a Cyclic Peptide Inhibitor of the Interaction between Viral Open Reading Frame 3 Protein and Host Tumor Susceptibility Gene 101. |
| Release_Year | 2018 |
| PMID | 30068652 |
| DOI | 10.1128/JVI.00684-18 |