PPIRE08204
Target Protein Information
| Protein_Name | Splicing factor 45 |
|---|---|
| Protein_Sequence | MSLYDDLGVETSDSKTEGWSKNFKLLQSQLQVKKAALTQAKSQRTKQSTVLAPVIDLKRGGSSDDRQIVDTPPHVAAGLKDPVPSGFSAGEVLIPLADEYDPMFPNDYEKVVKRQREERQRQRELERQKEIEEREKRRKDRHEASGFARRPDPDSDEDEDYERERRKRSMGGAAIAPPTSLVEKDKELPRDFPYEEDSRPRSQSSKAAIPPPVYEEQDRPRSPTGPSNSFLANMGGTVAHKIMQKYGFREGQGLGKHEQGLSTALSVEKTSKRGGKIIVGDATEKDASKKSDSNPLTEILKCPTKVVLLRNMVGAGEVDEDLEVETKEECEKYGKVGKCVIFEIPGAPDDEAVRIFLEFERVESAIKAVVDLNGRYFGGRVVKACFYNLDKFRVLDLAEQV |
| Organism_Source | Homo sapiens |
| Functional_Classification | RNA-binding proteins |
| Cellular_Localization | Nucleus |
| Gene_Names | RBM17 |
| UniProt_ID | Q96I25 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | peptide 8 |
|---|---|
| Peptide_Sequence | XKSRWDEK |
| Peptide_Length | 8 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)CN)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | X1=Nepsilon-methyllysine |
| Cyclization_Method | Side chain-side chain cyclization; X1<->E7; other bonds |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1005.10 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.12500 |
| Average_Rotatable_Bonds | 4.37500 |
| Charge_at_pH_7 | 0.99961 |
| Isoelectric_Point | 9.53485 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 15 |
| Number_of_Hydrogen_Bond_Donors | 18 |
| Topological_Polar_Surface_Area | 491.58000 |
| X_logP_energy | -4.99963 |
Interaction Information
| Affinity | KD=1.26 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Rational Design of Cyclic Peptide Inhibitors of U2AF Homology Motif (UHM)Domains To Modulate Pre-mRNA Splicing. |
| Release_Year | 2016 |
| PMID | 27753493 |
| DOI | 10.1021/acs.jmedchem.6b01118 |