PPIRE08254
Target Protein Information
| Protein_Name | Small ribosomal subunit protein uS2B |
|---|---|
| Protein_Sequence | MSGALDVLQMKEEDVLKFLAAGTHLGGTNLDFQMEHYIYKRKSDGIYIINLKRTWEKLLLAARAIVAIENPADVSVISSRNTGQRAVLKFAAATGATPIAGRFTPGTFTNQIQAAFWEPRLLVVTDPRADHQPLTEASYVNLPTIALCNTDSPLRYVDIAIPCNNKGAHSVGLMWWMLAREVLRMRGTISREHPWEVMPDLYFYRDPEEIEKEEQAAAEKAVTKEEFQGEWTAPSPEFTATQPEVADWSEGVQVPSVPIQQFPTEDWSAQPATEDWSAAPTAQATEWVGATTDWS |
| Organism_Source | Homo sapiens |
| Functional_Classification | laminin receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | RPSA2 |
| UniProt_ID | A0A8I5KQE6 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Lam.B1-(925-933) |
|---|---|
| Peptide_Sequence | CDPGYIGSR |
| Peptide_Length | 9 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CS)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 967.06 |
|---|---|
| Aliphatic_Index | 43.33333 |
| Aromaticity | 0.11111 |
| Average_Rotatable_Bonds | 3.11111 |
| Charge_at_pH_7 | -0.06440 |
| Isoelectric_Point | 6.15812 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 15 |
| Number_of_Hydrogen_Bond_Donors | 16 |
| Topological_Polar_Surface_Area | 426.99000 |
| X_logP_energy | -5.29983 |
Interaction Information
| Affinity | IC50=2.16 nM |
|---|---|
| Affinity_Assay | radioreceptor binding assay |
| PDB_ID | None |
| Type | antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Murine epidermal growth factor peptide (33-42)binds to a YIGSR-specific laminin receptor on both tumor and endothelial cells. |
| Release_Year | 1996 |
| PMID | 8824265 |
| DOI | 10.1074/jbc.271.42.26179 |