PPIRE08361
Target Protein Information
| Protein_Name | Ras GTPase-activating protein-binding protein 1 |
|---|---|
| Protein_Sequence | MVMEKPSPLLVGREFVRQYYTLLNQAPDMLHRFYGKNSSYVHGGLDSNGKPADAVYGQKEIHRKVMSQNFTNCHTKIRHVDAHATLNDGVVVQVMGLLSNNNQALRRFMQTFVLAPEGSVANKFYVHNDIFRYQDEVFGGFVTEPQEESEEEVEEPEERQQTPEVVPDDSGTFYDQAVVSNDMEEHLEEPVAEPEPDPEPEPEQEPVSEIQEEKPEPVLEETAPEDAQKSSSPAPADIAQTVQEDLRTFSWASVTSKNLPPSGAVPVTGIPPHVVKVPASQPRPESKPESQIPPQRPQRDQRVREQRINIPPQRGPRPIREAGEQGDIEPRRMVRHPDSHQLFIGNLPHEVDKSELKDFFQSYGNVVELRINSGGKLPNFGFVVFDDSEPVQKVLSNRPIMFRGEVRLNVEEKKTRAAREGDRRDNRLRGPGGPRGGLGGGMRGPPRGGMVQKPGFGVGRGLAPRQ |
| Organism_Source | Homo sapiens |
| Functional_Classification | nuclear transport factors |
| Cellular_Localization | Cytoplasm |
| Gene_Names | G3BP1 |
| UniProt_ID | Q13283 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | FxFG |
|---|---|
| Peptide_Sequence | DSGFSFGSK |
| Peptide_Length | 9 |
| Peptide_SMILES | NCCCC[C@H](NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@@H](N)CC(=O)O)C(=O)O |
| Chemical_Modification | |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 930.97 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.22222 |
| Average_Rotatable_Bonds | 3.33333 |
| Charge_at_pH_7 | -0.00186 |
| Isoelectric_Point | 6.33737 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 15 |
| Number_of_Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 420.13000 |
| X_logP_energy | -6.39450 |
Interaction Information
| Affinity | KD=11563 mM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 4FCM |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Crystal structures of the human G3BP1 NTF2-like domain visualize FxFG Nup repeat specificity. |
| Release_Year | 2013 |
| PMID | 24324649 |
| DOI | 10.1371/journal.pone.0080947 |