PPIRE08533
Target Protein Information
| Protein_Name | Bromodomain-containing protein 7 |
|---|---|
| Protein_Sequence | MGKKHKKHKSDKHLYEEYVEKPLKLVLKVGGNEVTELSTGSSGHDSSLFEDKNDHDKHKDRKRKKRKKGEKQIPGEEKGRKRRRVKEDKKKRDRDRVENEAEKDLQCHAPVRLDLPPEKPLTSSLAKQEEVEQTPLQEALNQLMRQLQRKDPSAFFSFPVTDFIAPGYSMIIKHPMDFSTMKEKIKNNDYQSIEELKDNFKLMCTNAMIYNKPETIYYKAAKKLLHSGMKILSQERIQSLKQSIDFMADLQKTRKQKDGTDTSQSGEDGGCWQREREDSGDAEAHAFKSPSKENKKKDKDMLEDKFKSNNLEREQEQLDRIVKESGGKLTRRLVNSQCEFERRKPDGTTTLGLLHPVDPIVGEPGYCPVRLGMTTGRLQSGVNTLQGFKEDKRNKVTPVLYLNYGPYSSYAPHYDSTFANISKDDSDLIYSTYGEDSDLPSDFSIHEFLATCQDYPYVMADSLLDVLTKGGHSRTLQEMEMSLPEDEGHTRTLDTAKEMEITEVEPPGRLDSSTQDRLIALKAVTNFGVPVEVFDSEEAEIFQKKLDETTRLLRELQEAQNERLSTRPPPNMICLLGPSYREMHLAEQVTNNLKELAQQVTPGDIVSTYGVRKAMGISIPSPVMENNFVDLTEDTEEPKKTDVAECGPGGS |
| Organism_Source | Homo sapiens |
| Functional_Classification | bromodomains |
| Cellular_Localization | Nucleus |
| Gene_Names | BRD7 |
| UniProt_ID | Q9NPI1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | H4 Ac-K12 |
|---|---|
| Peptide_Sequence | KGLGXGGAK |
| Peptide_Length | 9 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)CNC(=O)[C@@H](N)CCCCN)C(=O)NCC(=O)NCC(=O)NCC(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | X5=acetyllysine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 743.86 |
|---|---|
| Aliphatic_Index | 54.44444 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | 1.99739 |
| Isoelectric_Point | 10.80538 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 12 |
| Number_of_Hydrogen_Bond_Donors | 12 |
| Topological_Polar_Surface_Area | 348.16000 |
| X_logP_energy | -5.24230 |
Interaction Information
| Affinity | KD=3.42 mM |
|---|---|
| Affinity_Assay | NMR titration |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Solution structure of BRD7 bromodomain and its interaction with acetylated peptides from histone H3 and H4. |
| Release_Year | 2007 |
| PMID | 17498659 |
| DOI | 10.1016/j.bbrc.2007.04.139 |