PPIRE08604
Target Protein Information
| Protein_Name | EH domain-containing protein 1 |
|---|---|
| Protein_Sequence | MFSWVSKDARRKKEPELFQTVAEGLRQLYAQKLLPLEEHYRFHEFHSPALEDADFDNKPMVLLVGQYSTGKTTFIRHLIEQDFPGMRIGPEPTTDSFIAVMHGPTEGVVPGNALVVDPRRPFRKLNAFGNAFLNRFMCAQLPNPVLDSISIIDTPGILSGEKQRISRGYDFAAVLEWFAERVDRIILLFDAHKLDISDEFSEVIKALKNHEDKIRVVLNKADQIETQQLMRVYGALMWSLGKIINTPEVVRVYIGSFWSHPLLIPDNRKLFEAEEQDLFKDIQSLPRNAALRKLNDLIKRARLAKVHAYIISSLKKEMPNVFGKESKKKELVNNLGEIYQKIEREHQISPGDFPSLRKMQELLQTQDFSKFQALKPKLLDTVDDMLANDIARLMVMVRQEESLMPSQVVKGGAFDGTMNGPFGHGYGEGAGEGIDDVEWVVGKDKPTYDEIFYTLSPVNGKITGANAKKEMVKSKLPNTVLGKIWKLADVDKDGLLDDEEFALANHLIKVKLEGHELPADLPPHLVPPSKRRHE |
| Organism_Source | Homo sapiens |
| Functional_Classification | ATPases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | EHD1 |
| UniProt_ID | Q9H4M9 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | MICAL-L1 NPFEEEAAA |
|---|---|
| Peptide_Sequence | NPFEEEAAA |
| Peptide_Length | 9 |
| Peptide_SMILES | C[C@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CC(N)=O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 977.00 |
|---|---|
| Aliphatic_Index | 33.33333 |
| Aromaticity | 0.11111 |
| Average_Rotatable_Bonds | 3.22222 |
| Charge_at_pH_7 | -2.99669 |
| Isoelectric_Point | 3.47280 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 14 |
| Number_of_Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 442.32000 |
| X_logP_energy | -4.44490 |
Interaction Information
| Affinity | KD=54 uM |
|---|---|
| Affinity_Assay | NMR spectroscopy |
| PDB_ID | 2KSP |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Mechanism for the selective interaction of C-terminal Eps15 homology domain proteins with specific Asn-Pro-Phe-containing partners. |
| Release_Year | 2010 |
| PMID | 20106972 |
| DOI | 10.1074/jbc.M109.045666 |