PPIRE08618
Target Protein Information
| Protein_Name | Tumor susceptibility gene 101 protein |
|---|---|
| Protein_Sequence | MAVSESQLKKMVSKYKYRDLTVRETVNVITLYKDLKPVLDSYVFNDGSSRELMNLTGTIPVPYRGNTYNIPICLWLLDTYPYNPPICFVKPTSSMTIKTGKHVDANGKIYLPYLHEWKHPQSDLLGLIQVMIVVFGDEPPVFSRPISASYPPYQATGPPNTSYMPGMPGGISPYPSGYPPNPSGYPGCPYPPGGPYPATTSSQYPSQPPVTTVGPSRDGTISEDTIRASLISAVSDKLRWRMKEEMDRAQAELNALKRTEEDLKKGHQKLEEMVTRLDQEVAEVDKNIELLKKKDEELSSALEKMENQSENNDIDEVIIPTAPLYKQILNLYAEENAIEDTIFYLGEALRRGVIDLDVFLKHVRLLSRKQFQLRALMQKARKTAGLSDLY |
| Organism_Source | Homo sapiens |
| Functional_Classification | ubiquitin E2 variant |
| Cellular_Localization | Cytoplasm |
| Gene_Names | TSG101 |
| UniProt_ID | Q99816 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Gag PTAP P11A mutant |
|---|---|
| Peptide_Sequence | PEPTAPAEE |
| Peptide_Length | 9 |
| Peptide_SMILES | C[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(=O)O)NC(=O)[C@@H]1CCCN1)[C@@H](C)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 939.97 |
|---|---|
| Aliphatic_Index | 22.22222 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.77778 |
| Charge_at_pH_7 | -2.99669 |
| Isoelectric_Point | 3.47280 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 14 |
| Number_of_Hydrogen_Bond_Donors | 12 |
| Topological_Polar_Surface_Area | 396.68000 |
| X_logP_energy | -4.27120 |
Interaction Information
| Affinity | KD=170 mM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Crystallographic and functional analysis of the ESCRT-I /HIV-1 Gag PTAP interaction. |
| Release_Year | 2010 |
| PMID | 21070952 |
| DOI | 10.1016/j.str.2010.08.010 |