PPIRE08637
Target Protein Information
| Protein_Name | Prolyl 4-hydroxylase subunit alpha-1 |
|---|---|
| Protein_Sequence | MIWYILIIGILLPQSLAHPGFFTSIGQMTDLIHTEKDLVTSLKDYIKAEEDKLEQIKKWAEKLDRLTSTATKDPEGFVGHPVNAFKLMKRLNTEWSELENLVLKDMSDGFISNLTIQRQYFPNDEDQVGAAKALLRLQDTYNLDTDTISKGNLPGVKHKSFLTAEDCFELGKVAYTEADYYHTELWMEQALRQLDEGEISTIDKVSVLDYLSYAVYQQGDLDKALLLTKKLLELDPEHQRANGNLKYFEYIMAKEKDVNKSASDDQSDQKTTPKKKGVAVDYLPERQKYEMLCRGEGIKMTPRRQKKLFCRYHDGNRNPKFILAPAKQEDEWDKPRIIRFHDIISDAEIEIVKDLAKPRLRRATISNPITGDLETVHYRISKSAWLSGYENPVVSRINMRIQDLTGLDVSTAEELQVANYGVGGQYEPHFDFARKDEPDAFKELGTGNRIATWLFYMSDVSAGGATVFPEVGASVWPKKGTAVFWYNLFASGEGDYSTRHAACPVLVGNKWVSNKWLHERGQEFRRPCTLSELE |
| Organism_Source | Homo sapiens |
| Functional_Classification | Fe(II)/2-oxoglutarate (2OG)–dependent oxygenases（2OG-oxygenases） |
| Cellular_Localization | Cytoplasm |
| Gene_Names | P4HA1 |
| UniProt_ID | P13674 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | P9 |
|---|---|
| Peptide_Sequence | PPPPPPPPP |
| Peptide_Length | 9 |
| Peptide_SMILES | O=C(O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1 |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 892.07 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 1.00000 |
| Charge_at_pH_7 | -0.00202 |
| Isoelectric_Point | 6.10000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 10 |
| Number_of_Hydrogen_Bond_Donors | 2 |
| Topological_Polar_Surface_Area | 211.81000 |
| X_logP_energy | -0.24900 |
Interaction Information
| Affinity | KD=9.8 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 4BTB |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The structural motifs for substrate binding and dimerization of the Alpha subunit of collagen prolyl 4-hydroxylase. |
| Release_Year | 2013 |
| PMID | 24207127 |
| DOI | 10.1016/j.str.2013.09.005 |